C7H14N2 — CID 54266623
(1S,6S)-3-azabicyclo[4.2.0]octan-6-amine (PubChem CID 54266623) has the molecular formula C7H14N2 and a molecular weight of 126.20 g/mol. Its IUPAC name is (1S,6S)-3-azabicyclo[4.2.0]octan-6-amine.
| Compound Name | (1S,6S)-3-azabicyclo[4.2.0]octan-6-amine |
|---|---|
| PubChem CID | 54266623 |
| Molecular Formula | C7H14N2 |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.12 |
| IUPAC Name | (1S,6S)-3-azabicyclo[4.2.0]octan-6-amine |
| SMILES | N[C@@]12CCNC[C@@H]1CC2 |
| InChI | InChI=1S/C7H14N2/c8-7-2-1-6(7)5-9-4-3-7/h6,9H,1-5,8H2/t6-,7-/m0/s1 |
| InChIKey | RHEWRFDXODLVPE-BQBZGAKWSA-N |
| XLogP | 0.09 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |