About 2-(2,3-dimethylhexan-2-ylperoxy)-2,3-dimethylhexane
2-(2,3-dimethylhexan-2-ylperoxy)-2,3-dimethylhexane (PubChem CID 54266681) has the molecular formula C16H34O2
and a molecular weight of 258.45 g/mol. Its IUPAC name is 2-(2,3-dimethylhexan-2-ylperoxy)-2,3-dimethylhexane.
Molecular Properties
| Compound Name | 2-(2,3-dimethylhexan-2-ylperoxy)-2,3-dimethylhexane |
| PubChem CID | 54266681 |
| Molecular Formula | C16H34O2 |
| Molecular Weight | 258.45 g/mol |
| Exact Mass | 258.26 |
| IUPAC Name | 2-(2,3-dimethylhexan-2-ylperoxy)-2,3-dimethylhexane |
| SMILES | CCCC(C)C(C)(C)OOC(C)(C)C(C)CCC |
| InChI | InChI=1S/C16H34O2/c1-9-11-13(3)15(5,6)17-18-16(7,8)14(4)12-10-2/h13-14H,9-12H2,1-8H3 |
| InChIKey | RHFXPEJYOCZFGN-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 258.45 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,3-dimethylhexan-2-ylperoxy)-2,3-dimethylhexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,3-dimethylhexan-2-ylperoxy)-2,3-dimethylhexane?
The IUPAC name of 2-(2,3-dimethylhexan-2-ylperoxy)-2,3-dimethylhexane (CID 54266681) is 2-(2,3-dimethylhexan-2-ylperoxy)-2,3-dimethylhexane.
What is the SMILES notation for 2-(2,3-dimethylhexan-2-ylperoxy)-2,3-dimethylhexane?
The canonical SMILES for 2-(2,3-dimethylhexan-2-ylperoxy)-2,3-dimethylhexane is CCCC(C)C(C)(C)OOC(C)(C)C(C)CCC.
What is the InChIKey of 2-(2,3-dimethylhexan-2-ylperoxy)-2,3-dimethylhexane?
The InChIKey is RHFXPEJYOCZFGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H34O2/c1-9-11-13(3)15(5,6)17-18-16(7,8)14(4)12-10-2/h13-14H,9-12H2,1-8H3.
What are the key properties of 2-(2,3-dimethylhexan-2-ylperoxy)-2,3-dimethylhexane?
2-(2,3-dimethylhexan-2-ylperoxy)-2,3-dimethylhexane has a molecular weight of 258.45 g/mol, XLogP of 5.36, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,3-dimethylhexan-2-ylperoxy)-2,3-dimethylhexane is sourced from PubChem (CID 54266681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).