C29H33FN4O3 — CID 54266765
(2S)-2-(3-fluorophenyl)-3-[[2-[2-phenylethyl-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]amino]acetyl]amino]propanoic acid (PubChem CID 54266765) has the molecular formula C29H33FN4O3 and a molecular weight of 504.61 g/mol. Its IUPAC name is (2S)-2-(3-fluorophenyl)-3-[[2-[2-phenylethyl-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]amino]acetyl]amino]propanoic acid.
| Compound Name | (2S)-2-(3-fluorophenyl)-3-[[2-[2-phenylethyl-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]amino]acetyl]amino]propanoic acid |
|---|---|
| PubChem CID | 54266765 |
| Molecular Formula | C29H33FN4O3 |
| Molecular Weight | 504.61 g/mol |
| Exact Mass | 504.25 |
| IUPAC Name | (2S)-2-(3-fluorophenyl)-3-[[2-[2-phenylethyl-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]amino]acetyl]amino]propanoic acid |
| SMILES | O=C(CN(CCc1ccccc1)CCc1ccc2c(n1)NCCC2)NC[C@@H](C(=O)O)c1cccc(F)c1 |
| InChI | InChI=1S/C29H33FN4O3/c30-24-10-4-8-23(18-24)26(29(36)37)19-32-27(35)20-34(16-13-21-6-2-1-3-7-21)17-14-25-12-11-22-9-5-15-31-28(22)33-25/h1-4,6-8,10-12,18,26H,5,9,13-17,19-20H2,(H,31,33)(H,32,35)(H,36,37)/t26-/m1/s1 |
| InChIKey | RHHGDDHURWSOPC-AREMUKBSSA-N |
| XLogP | 3.65 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.61 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |