About 13-methyl-1,4-dioxa-13-azadispiro[4.0.56.45]pentadecan-12-one
13-methyl-1,4-dioxa-13-azadispiro[4.0.56.45]pentadecan-12-one (PubChem CID 54266863) has the molecular formula C13H21NO3
and a molecular weight of 239.31 g/mol. Its IUPAC name is 13-methyl-1,4-dioxa-13-azadispiro[4.0.56.45]pentadecan-12-one.
Molecular Properties
| Compound Name | 13-methyl-1,4-dioxa-13-azadispiro[4.0.56.45]pentadecan-12-one |
| PubChem CID | 54266863 |
| Molecular Formula | C13H21NO3 |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | 13-methyl-1,4-dioxa-13-azadispiro[4.0.56.45]pentadecan-12-one |
| SMILES | CN1CCC2(OCCO2)C2(CCCCC2)C1=O |
| InChI | InChI=1S/C13H21NO3/c1-14-8-7-13(16-9-10-17-13)12(11(14)15)5-3-2-4-6-12/h2-10H2,1H3 |
| InChIKey | RHJBYJPEKCTFST-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 13-methyl-1,4-dioxa-13-azadispiro[4.0.56.45]pentadecan-12-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 13-methyl-1,4-dioxa-13-azadispiro[4.0.56.45]pentadecan-12-one?
The IUPAC name of 13-methyl-1,4-dioxa-13-azadispiro[4.0.56.45]pentadecan-12-one (CID 54266863) is 13-methyl-1,4-dioxa-13-azadispiro[4.0.56.45]pentadecan-12-one.
What is the SMILES notation for 13-methyl-1,4-dioxa-13-azadispiro[4.0.56.45]pentadecan-12-one?
The canonical SMILES for 13-methyl-1,4-dioxa-13-azadispiro[4.0.56.45]pentadecan-12-one is CN1CCC2(OCCO2)C2(CCCCC2)C1=O.
What is the InChIKey of 13-methyl-1,4-dioxa-13-azadispiro[4.0.56.45]pentadecan-12-one?
The InChIKey is RHJBYJPEKCTFST-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21NO3/c1-14-8-7-13(16-9-10-17-13)12(11(14)15)5-3-2-4-6-12/h2-10H2,1H3.
What are the key properties of 13-methyl-1,4-dioxa-13-azadispiro[4.0.56.45]pentadecan-12-one?
13-methyl-1,4-dioxa-13-azadispiro[4.0.56.45]pentadecan-12-one has a molecular weight of 239.31 g/mol, XLogP of 1.54, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 13-methyl-1,4-dioxa-13-azadispiro[4.0.56.45]pentadecan-12-one is sourced from PubChem (CID 54266863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).