About (1R)-N,2-dimethylcyclopropan-1-amine
(1R)-N,2-dimethylcyclopropan-1-amine (PubChem CID 54266879) has the molecular formula C5H11N
and a molecular weight of 85.15 g/mol. Its IUPAC name is (1R)-N,2-dimethylcyclopropan-1-amine.
Molecular Properties
| Compound Name | (1R)-N,2-dimethylcyclopropan-1-amine |
| PubChem CID | 54266879 |
| Molecular Formula | C5H11N |
| Molecular Weight | 85.15 g/mol |
| Exact Mass | 85.09 |
| IUPAC Name | (1R)-N,2-dimethylcyclopropan-1-amine |
| SMILES | CN[C@@H]1CC1C |
| InChI | InChI=1S/C5H11N/c1-4-3-5(4)6-2/h4-6H,3H2,1-2H3/t4?,5-/m1/s1 |
| InChIKey | RHJITQJBHCWZLJ-BRJRFNKRSA-N |
| XLogP | 0.61 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 85.15 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (1R)-N,2-dimethylcyclopropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-N,2-dimethylcyclopropan-1-amine?
The IUPAC name of (1R)-N,2-dimethylcyclopropan-1-amine (CID 54266879) is (1R)-N,2-dimethylcyclopropan-1-amine.
What is the SMILES notation for (1R)-N,2-dimethylcyclopropan-1-amine?
The canonical SMILES for (1R)-N,2-dimethylcyclopropan-1-amine is CN[C@@H]1CC1C.
What is the InChIKey of (1R)-N,2-dimethylcyclopropan-1-amine?
The InChIKey is RHJITQJBHCWZLJ-BRJRFNKRSA-N. The full InChI is InChI=1S/C5H11N/c1-4-3-5(4)6-2/h4-6H,3H2,1-2H3/t4?,5-/m1/s1.
What are the key properties of (1R)-N,2-dimethylcyclopropan-1-amine?
(1R)-N,2-dimethylcyclopropan-1-amine has a molecular weight of 85.15 g/mol, XLogP of 0.61, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-N,2-dimethylcyclopropan-1-amine is sourced from PubChem (CID 54266879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).