C25H31F2N3OS — CID 54267533
N-[1-[4-(3,4-difluorophenoxy)butyl]piperidin-4-yl]-N-methyl-1,5-dihydro-2,4-benzothiazepin-3-amine (PubChem CID 54267533) has the molecular formula C25H31F2N3OS and a molecular weight of 459.61 g/mol. Its IUPAC name is N-[1-[4-(3,4-difluorophenoxy)butyl]piperidin-4-yl]-N-methyl-1,5-dihydro-2,4-benzothiazepin-3-amine.
| Compound Name | N-[1-[4-(3,4-difluorophenoxy)butyl]piperidin-4-yl]-N-methyl-1,5-dihydro-2,4-benzothiazepin-3-amine |
|---|---|
| PubChem CID | 54267533 |
| Molecular Formula | C25H31F2N3OS |
| Molecular Weight | 459.61 g/mol |
| Exact Mass | 459.22 |
| IUPAC Name | N-[1-[4-(3,4-difluorophenoxy)butyl]piperidin-4-yl]-N-methyl-1,5-dihydro-2,4-benzothiazepin-3-amine |
| SMILES | CN(C1=NCc2ccccc2CS1)C1CCN(CCCCOc2ccc(F)c(F)c2)CC1 |
| InChI | InChI=1S/C25H31F2N3OS/c1-29(25-28-17-19-6-2-3-7-20(19)18-32-25)21-10-13-30(14-11-21)12-4-5-15-31-22-8-9-23(26)24(27)16-22/h2-3,6-9,16,21H,4-5,10-15,17-18H2,1H3 |
| InChIKey | RHUOAFUZXRQRHM-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 28.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.61 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|