About 2-cyano-5-(6-propyl-1,3-benzodioxol-5-yl)penta-2,4-dienoic acid
2-cyano-5-(6-propyl-1,3-benzodioxol-5-yl)penta-2,4-dienoic acid (PubChem CID 54267991) has the molecular formula C16H15NO4
and a molecular weight of 285.30 g/mol. Its IUPAC name is 2-cyano-5-(6-propyl-1,3-benzodioxol-5-yl)penta-2,4-dienoic acid.
Molecular Properties
| Compound Name | 2-cyano-5-(6-propyl-1,3-benzodioxol-5-yl)penta-2,4-dienoic acid |
| PubChem CID | 54267991 |
| Molecular Formula | C16H15NO4 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | 2-cyano-5-(6-propyl-1,3-benzodioxol-5-yl)penta-2,4-dienoic acid |
| SMILES | CCCc1cc2c(cc1C=CC=C(C#N)C(=O)O)OCO2 |
| InChI | InChI=1S/C16H15NO4/c1-2-4-11-7-14-15(21-10-20-14)8-12(11)5-3-6-13(9-17)16(18)19/h3,5-8H,2,4,10H2,1H3,(H,18,19) |
| InChIKey | RICLVDVFNUXXDO-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 79.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-cyano-5-(6-propyl-1,3-benzodioxol-5-yl)penta-2,4-dienoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyano-5-(6-propyl-1,3-benzodioxol-5-yl)penta-2,4-dienoic acid?
The IUPAC name of 2-cyano-5-(6-propyl-1,3-benzodioxol-5-yl)penta-2,4-dienoic acid (CID 54267991) is 2-cyano-5-(6-propyl-1,3-benzodioxol-5-yl)penta-2,4-dienoic acid.
What is the SMILES notation for 2-cyano-5-(6-propyl-1,3-benzodioxol-5-yl)penta-2,4-dienoic acid?
The canonical SMILES for 2-cyano-5-(6-propyl-1,3-benzodioxol-5-yl)penta-2,4-dienoic acid is CCCc1cc2c(cc1C=CC=C(C#N)C(=O)O)OCO2.
What is the InChIKey of 2-cyano-5-(6-propyl-1,3-benzodioxol-5-yl)penta-2,4-dienoic acid?
The InChIKey is RICLVDVFNUXXDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15NO4/c1-2-4-11-7-14-15(21-10-20-14)8-12(11)5-3-6-13(9-17)16(18)19/h3,5-8H,2,4,10H2,1H3,(H,18,19).
What are the key properties of 2-cyano-5-(6-propyl-1,3-benzodioxol-5-yl)penta-2,4-dienoic acid?
2-cyano-5-(6-propyl-1,3-benzodioxol-5-yl)penta-2,4-dienoic acid has a molecular weight of 285.30 g/mol, XLogP of 2.92, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyano-5-(6-propyl-1,3-benzodioxol-5-yl)penta-2,4-dienoic acid is sourced from PubChem (CID 54267991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).