C18H24F2O4 — CID 54268129
methyl 5-[7-(difluoromethyl)-9,9-dimethyl-1,4-dioxaspiro[4.5]dec-6-en-8-yl]-3-methylpenta-2,4-dienoate (PubChem CID 54268129) has the molecular formula C18H24F2O4 and a molecular weight of 342.38 g/mol. Its IUPAC name is methyl 5-[7-(difluoromethyl)-9,9-dimethyl-1,4-dioxaspiro[4.5]dec-6-en-8-yl]-3-methylpenta-2,4-dienoate.
| Compound Name | methyl 5-[7-(difluoromethyl)-9,9-dimethyl-1,4-dioxaspiro[4.5]dec-6-en-8-yl]-3-methylpenta-2,4-dienoate |
|---|---|
| PubChem CID | 54268129 |
| Molecular Formula | C18H24F2O4 |
| Molecular Weight | 342.38 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | methyl 5-[7-(difluoromethyl)-9,9-dimethyl-1,4-dioxaspiro[4.5]dec-6-en-8-yl]-3-methylpenta-2,4-dienoate |
| SMILES | COC(=O)C=C(C)C=CC1C(C(F)F)=CC2(CC1(C)C)OCCO2 |
| InChI | InChI=1S/C18H24F2O4/c1-12(9-15(21)22-4)5-6-14-13(16(19)20)10-18(11-17(14,2)3)23-7-8-24-18/h5-6,9-10,14,16H,7-8,11H2,1-4H3 |
| InChIKey | RIFFFLIDZJUDQR-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.38 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|