C32H42N4O6 — CID 54268197
[(2R,3R,5S,6R)-2-(5-azidopentoxy)-5-hydroxy-6-(hydroxymethyl)-2-[2-(1H-indol-3-yl)ethyl]oxan-3-yl] 2,2-dimethyl-3-phenylpropanoate (PubChem CID 54268197) has the molecular formula C32H42N4O6 and a molecular weight of 578.71 g/mol. Its IUPAC name is [(2R,3R,5S,6R)-2-(5-azidopentoxy)-5-hydroxy-6-(hydroxymethyl)-2-[2-(1H-indol-3-yl)ethyl]oxan-3-yl] 2,2-dimethyl-3-phenylpropanoate.
| Compound Name | [(2R,3R,5S,6R)-2-(5-azidopentoxy)-5-hydroxy-6-(hydroxymethyl)-2-[2-(1H-indol-3-yl)ethyl]oxan-3-yl] 2,2-dimethyl-3-phenylpropanoate |
|---|---|
| PubChem CID | 54268197 |
| Molecular Formula | C32H42N4O6 |
| Molecular Weight | 578.71 g/mol |
| Exact Mass | 578.31 |
| IUPAC Name | [(2R,3R,5S,6R)-2-(5-azidopentoxy)-5-hydroxy-6-(hydroxymethyl)-2-[2-(1H-indol-3-yl)ethyl]oxan-3-yl] 2,2-dimethyl-3-phenylpropanoate |
| SMILES | CC(C)(Cc1ccccc1)C(=O)O[C@@H]1C[C@H](O)[C@@H](CO)O[C@@]1(CCc1c[nH]c2ccccc12)OCCCCCN=[N+]=[N-] |
| InChI | InChI=1S/C32H42N4O6/c1-31(2,20-23-11-5-3-6-12-23)30(39)41-29-19-27(38)28(22-37)42-32(29,40-18-10-4-9-17-35-36-33)16-15-24-21-34-26-14-8-7-13-25(24)26/h3,5-8,11-14,21,27-29,34,37-38H,4,9-10,15-20,22H2,1-2H3/t27-,28+,29+,32+/m0/s1 |
| InChIKey | RIGFLUVAZHNSKE-FQNXFSSYSA-N |
| XLogP | 5.62 |
| TPSA | 149.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.71 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|