About dithiolane 1,1-dioxide
dithiolane 1,1-dioxide (PubChem CID 542684) has the molecular formula C3H6O2S2
and a molecular weight of 138.21 g/mol. Its IUPAC name is dithiolane 1,1-dioxide.
Molecular Properties
| Compound Name | dithiolane 1,1-dioxide |
| PubChem CID | 542684 |
| Molecular Formula | C3H6O2S2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 137.98 |
| IUPAC Name | dithiolane 1,1-dioxide |
| SMILES | O=S1(=O)CCCS1 |
| InChI | InChI=1S/C3H6O2S2/c4-7(5)3-1-2-6-7/h1-3H2 |
| InChIKey | XYKJWCIOBXITBP-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|
Analyze dithiolane 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dithiolane 1,1-dioxide?
The IUPAC name of dithiolane 1,1-dioxide (CID 542684) is dithiolane 1,1-dioxide.
What is the SMILES notation for dithiolane 1,1-dioxide?
The canonical SMILES for dithiolane 1,1-dioxide is O=S1(=O)CCCS1.
What is the InChIKey of dithiolane 1,1-dioxide?
The InChIKey is XYKJWCIOBXITBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6O2S2/c4-7(5)3-1-2-6-7/h1-3H2.
What are the key properties of dithiolane 1,1-dioxide?
dithiolane 1,1-dioxide has a molecular weight of 138.21 g/mol, XLogP of 0.45, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dithiolane 1,1-dioxide is sourced from PubChem (CID 542684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).