C8H10F9NO — CID 54268554
2-(3,3,4,4,5,5,6,6,6-nonafluorohexoxy)ethanamine (PubChem CID 54268554) has the molecular formula C8H10F9NO and a molecular weight of 307.16 g/mol. Its IUPAC name is 2-(3,3,4,4,5,5,6,6,6-nonafluorohexoxy)ethanamine.
| Compound Name | 2-(3,3,4,4,5,5,6,6,6-nonafluorohexoxy)ethanamine |
|---|---|
| PubChem CID | 54268554 |
| Molecular Formula | C8H10F9NO |
| Molecular Weight | 307.16 g/mol |
| Exact Mass | 307.06 |
| IUPAC Name | 2-(3,3,4,4,5,5,6,6,6-nonafluorohexoxy)ethanamine |
| SMILES | NCCOCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H10F9NO/c9-5(10,1-3-19-4-2-18)6(11,12)7(13,14)8(15,16)17/h1-4,18H2 |
| InChIKey | RIMVMWUUFMQFBU-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.16 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|