About 5,6-dihydropyrido[3,4-d]pyrimidine
5,6-dihydropyrido[3,4-d]pyrimidine (PubChem CID 54268594) has the molecular formula C7H7N3
and a molecular weight of 133.15 g/mol. Its IUPAC name is 5,6-dihydropyrido[3,4-d]pyrimidine.
Molecular Properties
| Compound Name | 5,6-dihydropyrido[3,4-d]pyrimidine |
| PubChem CID | 54268594 |
| Molecular Formula | C7H7N3 |
| Molecular Weight | 133.15 g/mol |
| Exact Mass | 133.06 |
| IUPAC Name | 5,6-dihydropyrido[3,4-d]pyrimidine |
| SMILES | C1=NCCc2cncnc21 |
| InChI | InChI=1S/C7H7N3/c1-2-8-4-7-6(1)3-9-5-10-7/h3-5H,1-2H2 |
| InChIKey | CSLHPDBMTOAMIH-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 38.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.15 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5,6-dihydropyrido[3,4-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dihydropyrido[3,4-d]pyrimidine?
The IUPAC name of 5,6-dihydropyrido[3,4-d]pyrimidine (CID 54268594) is 5,6-dihydropyrido[3,4-d]pyrimidine.
What is the SMILES notation for 5,6-dihydropyrido[3,4-d]pyrimidine?
The canonical SMILES for 5,6-dihydropyrido[3,4-d]pyrimidine is C1=NCCc2cncnc21.
What is the InChIKey of 5,6-dihydropyrido[3,4-d]pyrimidine?
The InChIKey is CSLHPDBMTOAMIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3/c1-2-8-4-7-6(1)3-9-5-10-7/h3-5H,1-2H2.
What are the key properties of 5,6-dihydropyrido[3,4-d]pyrimidine?
5,6-dihydropyrido[3,4-d]pyrimidine has a molecular weight of 133.15 g/mol, XLogP of 0.45, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dihydropyrido[3,4-d]pyrimidine is sourced from PubChem (CID 54268594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).