About 2-ethylhexoxycarbonyloxyperoxy 2-ethylhexyl carbonate
2-ethylhexoxycarbonyloxyperoxy 2-ethylhexyl carbonate (PubChem CID 54268758) has the molecular formula C18H34O8
and a molecular weight of 378.46 g/mol. Its IUPAC name is 2-ethylhexoxycarbonyloxyperoxy 2-ethylhexyl carbonate.
Molecular Properties
| Compound Name | 2-ethylhexoxycarbonyloxyperoxy 2-ethylhexyl carbonate |
| PubChem CID | 54268758 |
| Molecular Formula | C18H34O8 |
| Molecular Weight | 378.46 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | 2-ethylhexoxycarbonyloxyperoxy 2-ethylhexyl carbonate |
| SMILES | CCCCC(CC)COC(=O)OOOOC(=O)OCC(CC)CCCC |
| InChI | InChI=1S/C18H34O8/c1-5-9-11-15(7-3)13-21-17(19)23-25-26-24-18(20)22-14-16(8-4)12-10-6-2/h15-16H,5-14H2,1-4H3 |
| InChIKey | RIQSLGAADRJNSG-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 378.46 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 2-ethylhexoxycarbonyloxyperoxy 2-ethylhexyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylhexoxycarbonyloxyperoxy 2-ethylhexyl carbonate?
The IUPAC name of 2-ethylhexoxycarbonyloxyperoxy 2-ethylhexyl carbonate (CID 54268758) is 2-ethylhexoxycarbonyloxyperoxy 2-ethylhexyl carbonate.
What is the SMILES notation for 2-ethylhexoxycarbonyloxyperoxy 2-ethylhexyl carbonate?
The canonical SMILES for 2-ethylhexoxycarbonyloxyperoxy 2-ethylhexyl carbonate is CCCCC(CC)COC(=O)OOOOC(=O)OCC(CC)CCCC.
What is the InChIKey of 2-ethylhexoxycarbonyloxyperoxy 2-ethylhexyl carbonate?
The InChIKey is RIQSLGAADRJNSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H34O8/c1-5-9-11-15(7-3)13-21-17(19)23-25-26-24-18(20)22-14-16(8-4)12-10-6-2/h15-16H,5-14H2,1-4H3.
What are the key properties of 2-ethylhexoxycarbonyloxyperoxy 2-ethylhexyl carbonate?
2-ethylhexoxycarbonyloxyperoxy 2-ethylhexyl carbonate has a molecular weight of 378.46 g/mol, XLogP of 5.50, 15 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylhexoxycarbonyloxyperoxy 2-ethylhexyl carbonate is sourced from PubChem (CID 54268758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).