C11H12BrNOS — CID 54269013
2-bromo-6-prop-2-enyl-5,6,7,8-tetrahydrothieno[3,2-c]azepin-4-one (PubChem CID 54269013) has the molecular formula C11H12BrNOS and a molecular weight of 286.19 g/mol. Its IUPAC name is 2-bromo-6-prop-2-enyl-5,6,7,8-tetrahydrothieno[3,2-c]azepin-4-one.
| Compound Name | 2-bromo-6-prop-2-enyl-5,6,7,8-tetrahydrothieno[3,2-c]azepin-4-one |
|---|---|
| PubChem CID | 54269013 |
| Molecular Formula | C11H12BrNOS |
| Molecular Weight | 286.19 g/mol |
| Exact Mass | 284.98 |
| IUPAC Name | 2-bromo-6-prop-2-enyl-5,6,7,8-tetrahydrothieno[3,2-c]azepin-4-one |
| SMILES | C=CCC1CCc2sc(Br)cc2C(=O)N1 |
| InChI | InChI=1S/C11H12BrNOS/c1-2-3-7-4-5-9-8(11(14)13-7)6-10(12)15-9/h2,6-7H,1,3-5H2,(H,13,14) |
| InChIKey | RIVMMRFJAAIONZ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.19 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|