About [2,2-bis(2-ethylhexanoyloxymethyl)-3-prop-2-enoyloxypropyl] 2-ethylhexanoate
[2,2-bis(2-ethylhexanoyloxymethyl)-3-prop-2-enoyloxypropyl] 2-ethylhexanoate (PubChem CID 54269185) has the molecular formula C32H56O8
and a molecular weight of 568.79 g/mol. Its IUPAC name is [2,2-bis(2-ethylhexanoyloxymethyl)-3-prop-2-enoyloxypropyl] 2-ethylhexanoate.
Molecular Properties
| Compound Name | [2,2-bis(2-ethylhexanoyloxymethyl)-3-prop-2-enoyloxypropyl] 2-ethylhexanoate |
| PubChem CID | 54269185 |
| Molecular Formula | C32H56O8 |
| Molecular Weight | 568.79 g/mol |
| Exact Mass | 568.40 |
| IUPAC Name | [2,2-bis(2-ethylhexanoyloxymethyl)-3-prop-2-enoyloxypropyl] 2-ethylhexanoate |
| SMILES | C=CC(=O)OCC(COC(=O)C(CC)CCCC)(COC(=O)C(CC)CCCC)COC(=O)C(CC)CCCC |
| InChI | InChI=1S/C32H56O8/c1-8-15-18-25(11-4)29(34)38-22-32(21-37-28(33)14-7,23-39-30(35)26(12-5)19-16-9-2)24-40-31(36)27(13-6)20-17-10-3/h14,25-27H,7-13,15-24H2,1-6H3 |
| InChIKey | RIYDCCNKLHKKMI-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 568.79 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [2,2-bis(2-ethylhexanoyloxymethyl)-3-prop-2-enoyloxypropyl] 2-ethylhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,2-bis(2-ethylhexanoyloxymethyl)-3-prop-2-enoyloxypropyl] 2-ethylhexanoate?
The IUPAC name of [2,2-bis(2-ethylhexanoyloxymethyl)-3-prop-2-enoyloxypropyl] 2-ethylhexanoate (CID 54269185) is [2,2-bis(2-ethylhexanoyloxymethyl)-3-prop-2-enoyloxypropyl] 2-ethylhexanoate.
What is the SMILES notation for [2,2-bis(2-ethylhexanoyloxymethyl)-3-prop-2-enoyloxypropyl] 2-ethylhexanoate?
The canonical SMILES for [2,2-bis(2-ethylhexanoyloxymethyl)-3-prop-2-enoyloxypropyl] 2-ethylhexanoate is C=CC(=O)OCC(COC(=O)C(CC)CCCC)(COC(=O)C(CC)CCCC)COC(=O)C(CC)CCCC.
What is the InChIKey of [2,2-bis(2-ethylhexanoyloxymethyl)-3-prop-2-enoyloxypropyl] 2-ethylhexanoate?
The InChIKey is RIYDCCNKLHKKMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H56O8/c1-8-15-18-25(11-4)29(34)38-22-32(21-37-28(33)14-7,23-39-30(35)26(12-5)19-16-9-2)24-40-31(36)27(13-6)20-17-10-3/h14,25-27H,7-13,15-24H2,1-6H3.
What are the key properties of [2,2-bis(2-ethylhexanoyloxymethyl)-3-prop-2-enoyloxypropyl] 2-ethylhexanoate?
[2,2-bis(2-ethylhexanoyloxymethyl)-3-prop-2-enoyloxypropyl] 2-ethylhexanoate has a molecular weight of 568.79 g/mol, XLogP of 6.98, 24 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [2,2-bis(2-ethylhexanoyloxymethyl)-3-prop-2-enoyloxypropyl] 2-ethylhexanoate is sourced from PubChem (CID 54269185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).