C9H16N2O — CID 54269285
N-methoxy-1-(1,2,3,6-tetrahydropyridin-5-yl)propan-1-imine (PubChem CID 54269285) has the molecular formula C9H16N2O and a molecular weight of 168.24 g/mol. Its IUPAC name is N-methoxy-1-(1,2,3,6-tetrahydropyridin-5-yl)propan-1-imine.
| Compound Name | N-methoxy-1-(1,2,3,6-tetrahydropyridin-5-yl)propan-1-imine |
|---|---|
| PubChem CID | 54269285 |
| Molecular Formula | C9H16N2O |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.13 |
| IUPAC Name | N-methoxy-1-(1,2,3,6-tetrahydropyridin-5-yl)propan-1-imine |
| SMILES | CCC(=NOC)C1=CCCNC1 |
| InChI | InChI=1S/C9H16N2O/c1-3-9(11-12-2)8-5-4-6-10-7-8/h5,10H,3-4,6-7H2,1-2H3 |
| InChIKey | RJAADGGMBVHEMP-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|