About [(4S,5R)-4,5-bis(methylsulfonyl)cyclohexen-1-yl]methanol
[(4S,5R)-4,5-bis(methylsulfonyl)cyclohexen-1-yl]methanol (PubChem CID 54270052) has the molecular formula C9H16O5S2
and a molecular weight of 268.36 g/mol. Its IUPAC name is [(4S,5R)-4,5-bis(methylsulfonyl)cyclohexen-1-yl]methanol.
Molecular Properties
| Compound Name | [(4S,5R)-4,5-bis(methylsulfonyl)cyclohexen-1-yl]methanol |
| PubChem CID | 54270052 |
| Molecular Formula | C9H16O5S2 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.04 |
| IUPAC Name | [(4S,5R)-4,5-bis(methylsulfonyl)cyclohexen-1-yl]methanol |
| SMILES | CS(=O)(=O)[C@@H]1CC(CO)=CC[C@@H]1S(C)(=O)=O |
| InChI | InChI=1S/C9H16O5S2/c1-15(11,12)8-4-3-7(6-10)5-9(8)16(2,13)14/h3,8-10H,4-6H2,1-2H3/t8-,9+/m0/s1 |
| InChIKey | RJMJCXZSRQEVEG-DTWKUNHWSA-N |
| XLogP | -0.47 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(4S,5R)-4,5-bis(methylsulfonyl)cyclohexen-1-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4S,5R)-4,5-bis(methylsulfonyl)cyclohexen-1-yl]methanol?
The IUPAC name of [(4S,5R)-4,5-bis(methylsulfonyl)cyclohexen-1-yl]methanol (CID 54270052) is [(4S,5R)-4,5-bis(methylsulfonyl)cyclohexen-1-yl]methanol.
What is the SMILES notation for [(4S,5R)-4,5-bis(methylsulfonyl)cyclohexen-1-yl]methanol?
The canonical SMILES for [(4S,5R)-4,5-bis(methylsulfonyl)cyclohexen-1-yl]methanol is CS(=O)(=O)[C@@H]1CC(CO)=CC[C@@H]1S(C)(=O)=O.
What is the InChIKey of [(4S,5R)-4,5-bis(methylsulfonyl)cyclohexen-1-yl]methanol?
The InChIKey is RJMJCXZSRQEVEG-DTWKUNHWSA-N. The full InChI is InChI=1S/C9H16O5S2/c1-15(11,12)8-4-3-7(6-10)5-9(8)16(2,13)14/h3,8-10H,4-6H2,1-2H3/t8-,9+/m0/s1.
What are the key properties of [(4S,5R)-4,5-bis(methylsulfonyl)cyclohexen-1-yl]methanol?
[(4S,5R)-4,5-bis(methylsulfonyl)cyclohexen-1-yl]methanol has a molecular weight of 268.36 g/mol, XLogP of -0.47, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(4S,5R)-4,5-bis(methylsulfonyl)cyclohexen-1-yl]methanol is sourced from PubChem (CID 54270052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).