C10H14N6O7 — CID 54270078
[2-amino-5-hydroxy-9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-oxo-1H-purin-4-yl] nitrite (PubChem CID 54270078) has the molecular formula C10H14N6O7 and a molecular weight of 330.26 g/mol. Its IUPAC name is [2-amino-5-hydroxy-9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-oxo-1H-purin-4-yl] nitrite.
| Compound Name | [2-amino-5-hydroxy-9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-oxo-1H-purin-4-yl] nitrite |
|---|---|
| PubChem CID | 54270078 |
| Molecular Formula | C10H14N6O7 |
| Molecular Weight | 330.26 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | [2-amino-5-hydroxy-9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-oxo-1H-purin-4-yl] nitrite |
| SMILES | NC1=NC2(ON=O)N([C@H]3C[C@H](O)[C@@H](CO)O3)C=NC2(O)C(=O)N1 |
| InChI | InChI=1S/C10H14N6O7/c11-8-13-7(19)9(20)10(14-8,23-15-21)16(3-12-9)6-1-4(18)5(2-17)22-6/h3-6,17-18,20H,1-2H2,(H3,11,13,14,19)/t4-,5+,6+,9?,10?/m0/s1 |
| InChIKey | RJMSXXAYWLXOLQ-OYZVGGFNSA-N |
| XLogP | -3.72 |
| TPSA | 191.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.26 |
| LogP ≤ 5 | -3.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|