C5H2N6O7 — CID 542701
3-nitro-4-[(4-nitro-1,2,5-oxadiazol-3-yl)oxymethyl]-1,2,5-oxadiazole (PubChem CID 542701) has the molecular formula C5H2N6O7 and a molecular weight of 258.11 g/mol. Its IUPAC name is 3-nitro-4-[(4-nitro-1,2,5-oxadiazol-3-yl)oxymethyl]-1,2,5-oxadiazole.
| Compound Name | 3-nitro-4-[(4-nitro-1,2,5-oxadiazol-3-yl)oxymethyl]-1,2,5-oxadiazole |
|---|---|
| PubChem CID | 542701 |
| Molecular Formula | C5H2N6O7 |
| Molecular Weight | 258.11 g/mol |
| Exact Mass | 258.00 |
| IUPAC Name | 3-nitro-4-[(4-nitro-1,2,5-oxadiazol-3-yl)oxymethyl]-1,2,5-oxadiazole |
| SMILES | O=[N+]([O-])c1nonc1COc1nonc1[N+](=O)[O-] |
| InChI | InChI=1S/C5H2N6O7/c12-10(13)3-2(6-17-7-3)1-16-5-4(11(14)15)8-18-9-5/h1H2 |
| InChIKey | WOXCRMFIBXEIBS-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 173.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.11 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|