C15H15NO4 — CID 54270356
3,6-dimethyl-4-phenyl-3,4-dihydropyridine-2,5-dicarboxylic acid (PubChem CID 54270356) has the molecular formula C15H15NO4 and a molecular weight of 273.29 g/mol. Its IUPAC name is 3,6-dimethyl-4-phenyl-3,4-dihydropyridine-2,5-dicarboxylic acid.
| Compound Name | 3,6-dimethyl-4-phenyl-3,4-dihydropyridine-2,5-dicarboxylic acid |
|---|---|
| PubChem CID | 54270356 |
| Molecular Formula | C15H15NO4 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | 3,6-dimethyl-4-phenyl-3,4-dihydropyridine-2,5-dicarboxylic acid |
| SMILES | CC1=C(C(=O)O)C(c2ccccc2)C(C)C(C(=O)O)=N1 |
| InChI | InChI=1S/C15H15NO4/c1-8-11(10-6-4-3-5-7-10)12(14(17)18)9(2)16-13(8)15(19)20/h3-8,11H,1-2H3,(H,17,18)(H,19,20) |
| InChIKey | RJRLLQDHCPMYKH-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 86.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |