About 2-amino-3-[[2-(2,4,6-trifluorophenyl)triazol-4-yl]methylideneamino]but-2-enedinitrile
2-amino-3-[[2-(2,4,6-trifluorophenyl)triazol-4-yl]methylideneamino]but-2-enedinitrile (PubChem CID 54270376) has the molecular formula C13H6F3N7
and a molecular weight of 317.23 g/mol. Its IUPAC name is 2-amino-3-[[2-(2,4,6-trifluorophenyl)triazol-4-yl]methylideneamino]but-2-enedinitrile.
Molecular Properties
| Compound Name | 2-amino-3-[[2-(2,4,6-trifluorophenyl)triazol-4-yl]methylideneamino]but-2-enedinitrile |
| PubChem CID | 54270376 |
| Molecular Formula | C13H6F3N7 |
| Molecular Weight | 317.23 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | 2-amino-3-[[2-(2,4,6-trifluorophenyl)triazol-4-yl]methylideneamino]but-2-enedinitrile |
| SMILES | N#CC(N)=C(C#N)/N=C/c1cnn(-c2c(F)cc(F)cc2F)n1 |
| InChI | InChI=1S/C13H6F3N7/c14-7-1-9(15)13(10(16)2-7)23-21-6-8(22-23)5-20-12(4-18)11(19)3-17/h1-2,5-6H,19H2/b12-11?,20-5+ |
| InChIKey | RJRPSZRKGSGIQH-UFYPKXKQSA-N |
| XLogP | 1.32 |
| TPSA | 116.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.23 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-3-[[2-(2,4,6-trifluorophenyl)triazol-4-yl]methylideneamino]but-2-enedinitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3-[[2-(2,4,6-trifluorophenyl)triazol-4-yl]methylideneamino]but-2-enedinitrile?
The IUPAC name of 2-amino-3-[[2-(2,4,6-trifluorophenyl)triazol-4-yl]methylideneamino]but-2-enedinitrile (CID 54270376) is 2-amino-3-[[2-(2,4,6-trifluorophenyl)triazol-4-yl]methylideneamino]but-2-enedinitrile.
What is the SMILES notation for 2-amino-3-[[2-(2,4,6-trifluorophenyl)triazol-4-yl]methylideneamino]but-2-enedinitrile?
The canonical SMILES for 2-amino-3-[[2-(2,4,6-trifluorophenyl)triazol-4-yl]methylideneamino]but-2-enedinitrile is N#CC(N)=C(C#N)/N=C/c1cnn(-c2c(F)cc(F)cc2F)n1.
What is the InChIKey of 2-amino-3-[[2-(2,4,6-trifluorophenyl)triazol-4-yl]methylideneamino]but-2-enedinitrile?
The InChIKey is RJRPSZRKGSGIQH-UFYPKXKQSA-N. The full InChI is InChI=1S/C13H6F3N7/c14-7-1-9(15)13(10(16)2-7)23-21-6-8(22-23)5-20-12(4-18)11(19)3-17/h1-2,5-6H,19H2/b12-11?,20-5+.
What are the key properties of 2-amino-3-[[2-(2,4,6-trifluorophenyl)triazol-4-yl]methylideneamino]but-2-enedinitrile?
2-amino-3-[[2-(2,4,6-trifluorophenyl)triazol-4-yl]methylideneamino]but-2-enedinitrile has a molecular weight of 317.23 g/mol, XLogP of 1.32, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-[[2-(2,4,6-trifluorophenyl)triazol-4-yl]methylideneamino]but-2-enedinitrile is sourced from PubChem (CID 54270376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).