C11H11N3 — CID 54270460
3-(1,2,3,6-tetrahydropyridin-6-yl)pyrrolo[3,4-b]pyrrole (PubChem CID 54270460) has the molecular formula C11H11N3 and a molecular weight of 185.23 g/mol. Its IUPAC name is 3-(1,2,3,6-tetrahydropyridin-6-yl)pyrrolo[3,4-b]pyrrole.
| Compound Name | 3-(1,2,3,6-tetrahydropyridin-6-yl)pyrrolo[3,4-b]pyrrole |
|---|---|
| PubChem CID | 54270460 |
| Molecular Formula | C11H11N3 |
| Molecular Weight | 185.23 g/mol |
| Exact Mass | 185.10 |
| IUPAC Name | 3-(1,2,3,6-tetrahydropyridin-6-yl)pyrrolo[3,4-b]pyrrole |
| SMILES | C1=CC(C2=CN=C3C=NC=C23)NCC1 |
| InChI | InChI=1S/C11H11N3/c1-2-4-13-10(3-1)9-6-14-11-7-12-5-8(9)11/h1,3,5-7,10,13H,2,4H2 |
| InChIKey | RJSZTBQKJFBMPX-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.23 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|