About [5-pent-1-enyl-2,6-di(propan-2-yl)-4-[4-(trifluoromethyl)phenyl]-3-pyridinyl]methanol
[5-pent-1-enyl-2,6-di(propan-2-yl)-4-[4-(trifluoromethyl)phenyl]-3-pyridinyl]methanol (PubChem CID 54270579) has the molecular formula C24H30F3NO
and a molecular weight of 405.50 g/mol. Its IUPAC name is [5-pent-1-enyl-2,6-di(propan-2-yl)-4-[4-(trifluoromethyl)phenyl]-3-pyridinyl]methanol.
Molecular Properties
| Compound Name | [5-pent-1-enyl-2,6-di(propan-2-yl)-4-[4-(trifluoromethyl)phenyl]-3-pyridinyl]methanol |
| PubChem CID | 54270579 |
| Molecular Formula | C24H30F3NO |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.23 |
| IUPAC Name | [5-pent-1-enyl-2,6-di(propan-2-yl)-4-[4-(trifluoromethyl)phenyl]-3-pyridinyl]methanol |
| SMILES | CCCC=Cc1c(C(C)C)nc(C(C)C)c(CO)c1-c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C24H30F3NO/c1-6-7-8-9-19-21(17-10-12-18(13-11-17)24(25,26)27)20(14-29)23(16(4)5)28-22(19)15(2)3/h8-13,15-16,29H,6-7,14H2,1-5H3 |
| InChIKey | RJUWSUZKIRWWHS-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [5-pent-1-enyl-2,6-di(propan-2-yl)-4-[4-(trifluoromethyl)phenyl]-3-pyridinyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-pent-1-enyl-2,6-di(propan-2-yl)-4-[4-(trifluoromethyl)phenyl]-3-pyridinyl]methanol?
The IUPAC name of [5-pent-1-enyl-2,6-di(propan-2-yl)-4-[4-(trifluoromethyl)phenyl]-3-pyridinyl]methanol (CID 54270579) is [5-pent-1-enyl-2,6-di(propan-2-yl)-4-[4-(trifluoromethyl)phenyl]-3-pyridinyl]methanol.
What is the SMILES notation for [5-pent-1-enyl-2,6-di(propan-2-yl)-4-[4-(trifluoromethyl)phenyl]-3-pyridinyl]methanol?
The canonical SMILES for [5-pent-1-enyl-2,6-di(propan-2-yl)-4-[4-(trifluoromethyl)phenyl]-3-pyridinyl]methanol is CCCC=Cc1c(C(C)C)nc(C(C)C)c(CO)c1-c1ccc(C(F)(F)F)cc1.
What is the InChIKey of [5-pent-1-enyl-2,6-di(propan-2-yl)-4-[4-(trifluoromethyl)phenyl]-3-pyridinyl]methanol?
The InChIKey is RJUWSUZKIRWWHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H30F3NO/c1-6-7-8-9-19-21(17-10-12-18(13-11-17)24(25,26)27)20(14-29)23(16(4)5)28-22(19)15(2)3/h8-13,15-16,29H,6-7,14H2,1-5H3.
What are the key properties of [5-pent-1-enyl-2,6-di(propan-2-yl)-4-[4-(trifluoromethyl)phenyl]-3-pyridinyl]methanol?
[5-pent-1-enyl-2,6-di(propan-2-yl)-4-[4-(trifluoromethyl)phenyl]-3-pyridinyl]methanol has a molecular weight of 405.50 g/mol, XLogP of 7.32, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [5-pent-1-enyl-2,6-di(propan-2-yl)-4-[4-(trifluoromethyl)phenyl]-3-pyridinyl]methanol is sourced from PubChem (CID 54270579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).