C28H44N2O2 — CID 54271084
2-(11-amino-2,2,12-trimethyltridecyl)-4,5-dihydrobenzo[e]isoindole-1,3-diol (PubChem CID 54271084) has the molecular formula C28H44N2O2 and a molecular weight of 440.67 g/mol. Its IUPAC name is 2-(11-amino-2,2,12-trimethyltridecyl)-4,5-dihydrobenzo[e]isoindole-1,3-diol.
| Compound Name | 2-(11-amino-2,2,12-trimethyltridecyl)-4,5-dihydrobenzo[e]isoindole-1,3-diol |
|---|---|
| PubChem CID | 54271084 |
| Molecular Formula | C28H44N2O2 |
| Molecular Weight | 440.67 g/mol |
| Exact Mass | 440.34 |
| IUPAC Name | 2-(11-amino-2,2,12-trimethyltridecyl)-4,5-dihydrobenzo[e]isoindole-1,3-diol |
| SMILES | CC(C)C(N)CCCCCCCCC(C)(C)Cn1c(O)c2c(c1O)-c1ccccc1CC2 |
| InChI | InChI=1S/C28H44N2O2/c1-20(2)24(29)15-9-7-5-6-8-12-18-28(3,4)19-30-26(31)23-17-16-21-13-10-11-14-22(21)25(23)27(30)32/h10-11,13-14,20,24,31-32H,5-9,12,15-19,29H2,1-4H3 |
| InChIKey | RKEFPAMHKCFRMT-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.67 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|