C19H26O13 — CID 54271293
methyl (4R,5R,6R)-2,4,5-triacetyloxy-6-[(1R)-1,2-diacetyloxyethyl]oxane-2-carboxylate (PubChem CID 54271293) has the molecular formula C19H26O13 and a molecular weight of 462.40 g/mol. Its IUPAC name is methyl (4R,5R,6R)-2,4,5-triacetyloxy-6-[(1R)-1,2-diacetyloxyethyl]oxane-2-carboxylate.
| Compound Name | methyl (4R,5R,6R)-2,4,5-triacetyloxy-6-[(1R)-1,2-diacetyloxyethyl]oxane-2-carboxylate |
|---|---|
| PubChem CID | 54271293 |
| Molecular Formula | C19H26O13 |
| Molecular Weight | 462.40 g/mol |
| Exact Mass | 462.14 |
| IUPAC Name | methyl (4R,5R,6R)-2,4,5-triacetyloxy-6-[(1R)-1,2-diacetyloxyethyl]oxane-2-carboxylate |
| SMILES | COC(=O)C1(OC(C)=O)C[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]([C@@H](COC(C)=O)OC(C)=O)O1 |
| InChI | InChI=1S/C19H26O13/c1-9(20)27-8-15(29-11(3)22)17-16(30-12(4)23)14(28-10(2)21)7-19(32-17,18(25)26-6)31-13(5)24/h14-17H,7-8H2,1-6H3/t14-,15-,16-,17-,19?/m1/s1 |
| InChIKey | RKHXURDVRUYZFB-ROYKXYEVSA-N |
| XLogP | -0.43 |
| TPSA | 167.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.40 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|