C27H38O3S — CID 54271444
[9-methoxy-3,7-dimethyl-1-(2,6,6-trimethylcyclohexen-1-yl)nona-1,3,7-trien-5-yl]sulfonylbenzene (PubChem CID 54271444) has the molecular formula C27H38O3S and a molecular weight of 442.67 g/mol. Its IUPAC name is [9-methoxy-3,7-dimethyl-1-(2,6,6-trimethylcyclohexen-1-yl)nona-1,3,7-trien-5-yl]sulfonylbenzene.
| Compound Name | [9-methoxy-3,7-dimethyl-1-(2,6,6-trimethylcyclohexen-1-yl)nona-1,3,7-trien-5-yl]sulfonylbenzene |
|---|---|
| PubChem CID | 54271444 |
| Molecular Formula | C27H38O3S |
| Molecular Weight | 442.67 g/mol |
| Exact Mass | 442.25 |
| IUPAC Name | [9-methoxy-3,7-dimethyl-1-(2,6,6-trimethylcyclohexen-1-yl)nona-1,3,7-trien-5-yl]sulfonylbenzene |
| SMILES | COCC=C(C)CC(C=C(C)C=CC1=C(C)CCCC1(C)C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C27H38O3S/c1-21(14-15-26-23(3)11-10-17-27(26,4)5)19-25(20-22(2)16-18-30-6)31(28,29)24-12-8-7-9-13-24/h7-9,12-16,19,25H,10-11,17-18,20H2,1-6H3 |
| InChIKey | RKKNNEYCPAJXFN-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.67 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|