C13H15NO4 — CID 54271480
2-(propylamino)naphthalene-1,4,5,8-tetrol (PubChem CID 54271480) has the molecular formula C13H15NO4 and a molecular weight of 249.27 g/mol. Its IUPAC name is 2-(propylamino)naphthalene-1,4,5,8-tetrol.
| Compound Name | 2-(propylamino)naphthalene-1,4,5,8-tetrol |
|---|---|
| PubChem CID | 54271480 |
| Molecular Formula | C13H15NO4 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 2-(propylamino)naphthalene-1,4,5,8-tetrol |
| SMILES | CCCNc1cc(O)c2c(O)ccc(O)c2c1O |
| InChI | InChI=1S/C13H15NO4/c1-2-5-14-7-6-10(17)11-8(15)3-4-9(16)12(11)13(7)18/h3-4,6,14-18H,2,5H2,1H3 |
| InChIKey | RKLGDITWDQLTSB-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 92.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|