About N-[[4-[(5-benzylidene-3,6-dioxopiperazin-2-ylidene)methyl]phenyl]methyl]acetamide
N-[[4-[(5-benzylidene-3,6-dioxopiperazin-2-ylidene)methyl]phenyl]methyl]acetamide (PubChem CID 54271693) has the molecular formula C21H19N3O3
and a molecular weight of 361.40 g/mol. Its IUPAC name is N-[[4-[(5-benzylidene-3,6-dioxopiperazin-2-ylidene)methyl]phenyl]methyl]acetamide.
Molecular Properties
| Compound Name | N-[[4-[(5-benzylidene-3,6-dioxopiperazin-2-ylidene)methyl]phenyl]methyl]acetamide |
| PubChem CID | 54271693 |
| Molecular Formula | C21H19N3O3 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | N-[[4-[(5-benzylidene-3,6-dioxopiperazin-2-ylidene)methyl]phenyl]methyl]acetamide |
| SMILES | CC(=O)NCc1ccc(C=c2[nH]c(=O)c(=Cc3ccccc3)[nH]c2=O)cc1 |
| InChI | InChI=1S/C21H19N3O3/c1-14(25)22-13-17-9-7-16(8-10-17)12-19-21(27)23-18(20(26)24-19)11-15-5-3-2-4-6-15/h2-12H,13H2,1H3,(H,22,25)(H,23,27)(H,24,26) |
| InChIKey | RKOYJMRWWXYRES-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[[4-[(5-benzylidene-3,6-dioxopiperazin-2-ylidene)methyl]phenyl]methyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[4-[(5-benzylidene-3,6-dioxopiperazin-2-ylidene)methyl]phenyl]methyl]acetamide?
The IUPAC name of N-[[4-[(5-benzylidene-3,6-dioxopiperazin-2-ylidene)methyl]phenyl]methyl]acetamide (CID 54271693) is N-[[4-[(5-benzylidene-3,6-dioxopiperazin-2-ylidene)methyl]phenyl]methyl]acetamide.
What is the SMILES notation for N-[[4-[(5-benzylidene-3,6-dioxopiperazin-2-ylidene)methyl]phenyl]methyl]acetamide?
The canonical SMILES for N-[[4-[(5-benzylidene-3,6-dioxopiperazin-2-ylidene)methyl]phenyl]methyl]acetamide is CC(=O)NCc1ccc(C=c2[nH]c(=O)c(=Cc3ccccc3)[nH]c2=O)cc1.
What is the InChIKey of N-[[4-[(5-benzylidene-3,6-dioxopiperazin-2-ylidene)methyl]phenyl]methyl]acetamide?
The InChIKey is RKOYJMRWWXYRES-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19N3O3/c1-14(25)22-13-17-9-7-16(8-10-17)12-19-21(27)23-18(20(26)24-19)11-15-5-3-2-4-6-15/h2-12H,13H2,1H3,(H,22,25)(H,23,27)(H,24,26).
What are the key properties of N-[[4-[(5-benzylidene-3,6-dioxopiperazin-2-ylidene)methyl]phenyl]methyl]acetamide?
N-[[4-[(5-benzylidene-3,6-dioxopiperazin-2-ylidene)methyl]phenyl]methyl]acetamide has a molecular weight of 361.40 g/mol, XLogP of 0.36, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[4-[(5-benzylidene-3,6-dioxopiperazin-2-ylidene)methyl]phenyl]methyl]acetamide is sourced from PubChem (CID 54271693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).