C38H66N4O6 — CID 54272081
4-[6-[3-carboxypropanoyl-(2,2,6,6-tetramethyl-1-prop-2-enylpiperidin-4-yl)amino]hexyl-(2,2,6,6-tetramethyl-1-prop-2-enylpiperidin-4-yl)amino]-4-oxobutanoic acid (PubChem CID 54272081) has the molecular formula C38H66N4O6 and a molecular weight of 674.97 g/mol. Its IUPAC name is 4-[6-[3-carboxypropanoyl-(2,2,6,6-tetramethyl-1-prop-2-enylpiperidin-4-yl)amino]hexyl-(2,2,6,6-tetramethyl-1-prop-2-enylpiperidin-4-yl)amino]-4-oxobutanoic acid.
| Compound Name | 4-[6-[3-carboxypropanoyl-(2,2,6,6-tetramethyl-1-prop-2-enylpiperidin-4-yl)amino]hexyl-(2,2,6,6-tetramethyl-1-prop-2-enylpiperidin-4-yl)amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 54272081 |
| Molecular Formula | C38H66N4O6 |
| Molecular Weight | 674.97 g/mol |
| Exact Mass | 674.50 |
| IUPAC Name | 4-[6-[3-carboxypropanoyl-(2,2,6,6-tetramethyl-1-prop-2-enylpiperidin-4-yl)amino]hexyl-(2,2,6,6-tetramethyl-1-prop-2-enylpiperidin-4-yl)amino]-4-oxobutanoic acid |
| SMILES | C=CCN1C(C)(C)CC(N(CCCCCCN(C(=O)CCC(=O)O)C2CC(C)(C)N(CC=C)C(C)(C)C2)C(=O)CCC(=O)O)CC1(C)C |
| InChI | InChI=1S/C38H66N4O6/c1-11-21-41-35(3,4)25-29(26-36(41,5)6)39(31(43)17-19-33(45)46)23-15-13-14-16-24-40(32(44)18-20-34(47)48)30-27-37(7,8)42(22-12-2)38(9,10)28-30/h11-12,29-30H,1-2,13-28H2,3-10H3,(H,45,46)(H,47,48) |
| InChIKey | RKWBSLAJNJBMEN-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 121.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.97 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|