About 7-[(3R,4R)-4-(cyclohexyloxymethyl)thiolan-3-yl]heptanoic acid
7-[(3R,4R)-4-(cyclohexyloxymethyl)thiolan-3-yl]heptanoic acid (PubChem CID 54272114) has the molecular formula C18H32O3S
and a molecular weight of 328.52 g/mol. Its IUPAC name is 7-[(3R,4R)-4-(cyclohexyloxymethyl)thiolan-3-yl]heptanoic acid.
Molecular Properties
| Compound Name | 7-[(3R,4R)-4-(cyclohexyloxymethyl)thiolan-3-yl]heptanoic acid |
| PubChem CID | 54272114 |
| Molecular Formula | C18H32O3S |
| Molecular Weight | 328.52 g/mol |
| Exact Mass | 328.21 |
| IUPAC Name | 7-[(3R,4R)-4-(cyclohexyloxymethyl)thiolan-3-yl]heptanoic acid |
| SMILES | O=C(O)CCCCCC[C@H]1CSC[C@H]1COC1CCCCC1 |
| InChI | InChI=1S/C18H32O3S/c19-18(20)11-7-2-1-4-8-15-13-22-14-16(15)12-21-17-9-5-3-6-10-17/h15-17H,1-14H2,(H,19,20)/t15-,16+/m0/s1 |
| InChIKey | RKWPQLSGRCLDMI-JKSUJKDBSA-N |
| XLogP | 4.74 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.52 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 7-[(3R,4R)-4-(cyclohexyloxymethyl)thiolan-3-yl]heptanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[(3R,4R)-4-(cyclohexyloxymethyl)thiolan-3-yl]heptanoic acid?
The IUPAC name of 7-[(3R,4R)-4-(cyclohexyloxymethyl)thiolan-3-yl]heptanoic acid (CID 54272114) is 7-[(3R,4R)-4-(cyclohexyloxymethyl)thiolan-3-yl]heptanoic acid.
What is the SMILES notation for 7-[(3R,4R)-4-(cyclohexyloxymethyl)thiolan-3-yl]heptanoic acid?
The canonical SMILES for 7-[(3R,4R)-4-(cyclohexyloxymethyl)thiolan-3-yl]heptanoic acid is O=C(O)CCCCCC[C@H]1CSC[C@H]1COC1CCCCC1.
What is the InChIKey of 7-[(3R,4R)-4-(cyclohexyloxymethyl)thiolan-3-yl]heptanoic acid?
The InChIKey is RKWPQLSGRCLDMI-JKSUJKDBSA-N. The full InChI is InChI=1S/C18H32O3S/c19-18(20)11-7-2-1-4-8-15-13-22-14-16(15)12-21-17-9-5-3-6-10-17/h15-17H,1-14H2,(H,19,20)/t15-,16+/m0/s1.
What are the key properties of 7-[(3R,4R)-4-(cyclohexyloxymethyl)thiolan-3-yl]heptanoic acid?
7-[(3R,4R)-4-(cyclohexyloxymethyl)thiolan-3-yl]heptanoic acid has a molecular weight of 328.52 g/mol, XLogP of 4.74, 10 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[(3R,4R)-4-(cyclohexyloxymethyl)thiolan-3-yl]heptanoic acid is sourced from PubChem (CID 54272114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).