7-[(3R,4R)-4-(cyclohexyloxymethyl)thiolan-3-yl]heptanoic acid

C18H32O3S — CID 54272114

IUPAC7-[(3R,4R)-4-(cyclohexyloxymethyl)thiolan-3-yl]heptanoic acid
SMILESO=C(O)CCCCCC[C@H]1CSC[C@H]1COC1CCCCC1
InChIInChI=1S/C18H32O3S/c19-18(20)11-7-2-1-4-8-15-13-22-14-16(15)12-21-17-9-5-3-6-10-17/h15-17H,1-14H2,(H,19,20)/t15-,16+/m0/s1
InChIKeyRKWPQLSGRCLDMI-JKSUJKDBSA-N
MW328.52 g/mol
LogP4.74
Rot. Bonds10

About 7-[(3R,4R)-4-(cyclohexyloxymethyl)thiolan-3-yl]heptanoic acid

7-[(3R,4R)-4-(cyclohexyloxymethyl)thiolan-3-yl]heptanoic acid (PubChem CID 54272114) has the molecular formula C18H32O3S and a molecular weight of 328.52 g/mol. Its IUPAC name is 7-[(3R,4R)-4-(cyclohexyloxymethyl)thiolan-3-yl]heptanoic acid.

Molecular Properties

Compound Name7-[(3R,4R)-4-(cyclohexyloxymethyl)thiolan-3-yl]heptanoic acid
PubChem CID54272114
Molecular FormulaC18H32O3S
Molecular Weight328.52 g/mol
Exact Mass328.21
IUPAC Name7-[(3R,4R)-4-(cyclohexyloxymethyl)thiolan-3-yl]heptanoic acid
SMILESO=C(O)CCCCCC[C@H]1CSC[C@H]1COC1CCCCC1
InChIInChI=1S/C18H32O3S/c19-18(20)11-7-2-1-4-8-15-13-22-14-16(15)12-21-17-9-5-3-6-10-17/h15-17H,1-14H2,(H,19,20)/t15-,16+/m0/s1
InChIKeyRKWPQLSGRCLDMI-JKSUJKDBSA-N
XLogP4.74
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds10
Heavy Atoms22
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500328.52
LogP ≤ 54.74
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 7-[(3R,4R)-4-(cyclohexyloxymethyl)thiolan-3-yl]heptanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 7-[(3R,4R)-4-(cyclohexyloxymethyl)thiolan-3-yl]heptanoic acid?
The IUPAC name of 7-[(3R,4R)-4-(cyclohexyloxymethyl)thiolan-3-yl]heptanoic acid (CID 54272114) is 7-[(3R,4R)-4-(cyclohexyloxymethyl)thiolan-3-yl]heptanoic acid.
What is the SMILES notation for 7-[(3R,4R)-4-(cyclohexyloxymethyl)thiolan-3-yl]heptanoic acid?
The canonical SMILES for 7-[(3R,4R)-4-(cyclohexyloxymethyl)thiolan-3-yl]heptanoic acid is O=C(O)CCCCCC[C@H]1CSC[C@H]1COC1CCCCC1.
What is the InChIKey of 7-[(3R,4R)-4-(cyclohexyloxymethyl)thiolan-3-yl]heptanoic acid?
The InChIKey is RKWPQLSGRCLDMI-JKSUJKDBSA-N. The full InChI is InChI=1S/C18H32O3S/c19-18(20)11-7-2-1-4-8-15-13-22-14-16(15)12-21-17-9-5-3-6-10-17/h15-17H,1-14H2,(H,19,20)/t15-,16+/m0/s1.
What are the key properties of 7-[(3R,4R)-4-(cyclohexyloxymethyl)thiolan-3-yl]heptanoic acid?
7-[(3R,4R)-4-(cyclohexyloxymethyl)thiolan-3-yl]heptanoic acid has a molecular weight of 328.52 g/mol, XLogP of 4.74, 10 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[(3R,4R)-4-(cyclohexyloxymethyl)thiolan-3-yl]heptanoic acid is sourced from PubChem (CID 54272114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).