About dibutoxy-[(3,5-dichloro-6-fluoro-2-pyridinyl)oxy]-sulfanylidene-λ5-phosphane
dibutoxy-[(3,5-dichloro-6-fluoro-2-pyridinyl)oxy]-sulfanylidene-λ5-phosphane (PubChem CID 54272428) has the molecular formula C13H19Cl2FNO3PS
and a molecular weight of 390.24 g/mol. Its IUPAC name is dibutoxy-[(3,5-dichloro-6-fluoro-2-pyridinyl)oxy]-sulfanylidene-λ5-phosphane.
Molecular Properties
| Compound Name | dibutoxy-[(3,5-dichloro-6-fluoro-2-pyridinyl)oxy]-sulfanylidene-λ5-phosphane |
| PubChem CID | 54272428 |
| Molecular Formula | C13H19Cl2FNO3PS |
| Molecular Weight | 390.24 g/mol |
| Exact Mass | 389.02 |
| IUPAC Name | dibutoxy-[(3,5-dichloro-6-fluoro-2-pyridinyl)oxy]-sulfanylidene-λ5-phosphane |
| SMILES | CCCCOP(=S)(OCCCC)Oc1nc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C13H19Cl2FNO3PS/c1-3-5-7-18-21(22,19-8-6-4-2)20-13-11(15)9-10(14)12(16)17-13/h9H,3-8H2,1-2H3 |
| InChIKey | RLCDUARMAHURMY-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 390.24 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dibutoxy-[(3,5-dichloro-6-fluoro-2-pyridinyl)oxy]-sulfanylidene-λ5-phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibutoxy-[(3,5-dichloro-6-fluoro-2-pyridinyl)oxy]-sulfanylidene-λ5-phosphane?
The IUPAC name of dibutoxy-[(3,5-dichloro-6-fluoro-2-pyridinyl)oxy]-sulfanylidene-λ5-phosphane (CID 54272428) is dibutoxy-[(3,5-dichloro-6-fluoro-2-pyridinyl)oxy]-sulfanylidene-λ5-phosphane.
What is the SMILES notation for dibutoxy-[(3,5-dichloro-6-fluoro-2-pyridinyl)oxy]-sulfanylidene-λ5-phosphane?
The canonical SMILES for dibutoxy-[(3,5-dichloro-6-fluoro-2-pyridinyl)oxy]-sulfanylidene-λ5-phosphane is CCCCOP(=S)(OCCCC)Oc1nc(F)c(Cl)cc1Cl.
What is the InChIKey of dibutoxy-[(3,5-dichloro-6-fluoro-2-pyridinyl)oxy]-sulfanylidene-λ5-phosphane?
The InChIKey is RLCDUARMAHURMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19Cl2FNO3PS/c1-3-5-7-18-21(22,19-8-6-4-2)20-13-11(15)9-10(14)12(16)17-13/h9H,3-8H2,1-2H3.
What are the key properties of dibutoxy-[(3,5-dichloro-6-fluoro-2-pyridinyl)oxy]-sulfanylidene-λ5-phosphane?
dibutoxy-[(3,5-dichloro-6-fluoro-2-pyridinyl)oxy]-sulfanylidene-λ5-phosphane has a molecular weight of 390.24 g/mol, XLogP of 5.76, 10 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dibutoxy-[(3,5-dichloro-6-fluoro-2-pyridinyl)oxy]-sulfanylidene-λ5-phosphane is sourced from PubChem (CID 54272428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).