About 7-[5-(dimethylamino)hexyl]-3,7-dimethylpurin-7-ium-2,6-dione
7-[5-(dimethylamino)hexyl]-3,7-dimethylpurin-7-ium-2,6-dione (PubChem CID 54272657) has the molecular formula C15H26N5O2+
and a molecular weight of 308.41 g/mol. Its IUPAC name is 7-[5-(dimethylamino)hexyl]-3,7-dimethylpurin-7-ium-2,6-dione.
Molecular Properties
| Compound Name | 7-[5-(dimethylamino)hexyl]-3,7-dimethylpurin-7-ium-2,6-dione |
| PubChem CID | 54272657 |
| Molecular Formula | C15H26N5O2+ |
| Molecular Weight | 308.41 g/mol |
| Exact Mass | 308.21 |
| IUPAC Name | 7-[5-(dimethylamino)hexyl]-3,7-dimethylpurin-7-ium-2,6-dione |
| SMILES | CC(CCCC[N+]1(C)C=Nc2c1c(=O)[nH]c(=O)n2C)N(C)C |
| InChI | InChI=1S/C15H25N5O2/c1-11(18(2)3)8-6-7-9-20(5)10-16-13-12(20)14(21)17-15(22)19(13)4/h10-11H,6-9H2,1-5H3/p+1 |
| InChIKey | AWICPQCPZZQAKT-UHFFFAOYSA-O |
| XLogP | 0.80 |
| TPSA | 70.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.41 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 7-[5-(dimethylamino)hexyl]-3,7-dimethylpurin-7-ium-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[5-(dimethylamino)hexyl]-3,7-dimethylpurin-7-ium-2,6-dione?
The IUPAC name of 7-[5-(dimethylamino)hexyl]-3,7-dimethylpurin-7-ium-2,6-dione (CID 54272657) is 7-[5-(dimethylamino)hexyl]-3,7-dimethylpurin-7-ium-2,6-dione.
What is the SMILES notation for 7-[5-(dimethylamino)hexyl]-3,7-dimethylpurin-7-ium-2,6-dione?
The canonical SMILES for 7-[5-(dimethylamino)hexyl]-3,7-dimethylpurin-7-ium-2,6-dione is CC(CCCC[N+]1(C)C=Nc2c1c(=O)[nH]c(=O)n2C)N(C)C.
What is the InChIKey of 7-[5-(dimethylamino)hexyl]-3,7-dimethylpurin-7-ium-2,6-dione?
The InChIKey is AWICPQCPZZQAKT-UHFFFAOYSA-O. The full InChI is InChI=1S/C15H25N5O2/c1-11(18(2)3)8-6-7-9-20(5)10-16-13-12(20)14(21)17-15(22)19(13)4/h10-11H,6-9H2,1-5H3/p+1.
What are the key properties of 7-[5-(dimethylamino)hexyl]-3,7-dimethylpurin-7-ium-2,6-dione?
7-[5-(dimethylamino)hexyl]-3,7-dimethylpurin-7-ium-2,6-dione has a molecular weight of 308.41 g/mol, XLogP of 0.80, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[5-(dimethylamino)hexyl]-3,7-dimethylpurin-7-ium-2,6-dione is sourced from PubChem (CID 54272657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).