C16H26Cl2N6O — CID 54272987
1-[1-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]pentan-2-yl]-3,3,5,5-tetramethylpiperazin-2-one (PubChem CID 54272987) has the molecular formula C16H26Cl2N6O and a molecular weight of 389.33 g/mol. Its IUPAC name is 1-[1-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]pentan-2-yl]-3,3,5,5-tetramethylpiperazin-2-one.
| Compound Name | 1-[1-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]pentan-2-yl]-3,3,5,5-tetramethylpiperazin-2-one |
|---|---|
| PubChem CID | 54272987 |
| Molecular Formula | C16H26Cl2N6O |
| Molecular Weight | 389.33 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | 1-[1-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]pentan-2-yl]-3,3,5,5-tetramethylpiperazin-2-one |
| SMILES | CCCC(CNc1nc(Cl)nc(Cl)n1)N1CC(C)(C)NC(C)(C)C1=O |
| InChI | InChI=1S/C16H26Cl2N6O/c1-6-7-10(8-19-14-21-12(17)20-13(18)22-14)24-9-15(2,3)23-16(4,5)11(24)25/h10,23H,6-9H2,1-5H3,(H,19,20,21,22) |
| InChIKey | RLLQYXZSGIGMOH-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 83.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.33 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |