C21H31N5O2 — CID 54273326
7-piperidin-1-yl-3-(1-pyrimidin-4-ylpiperidin-4-yl)-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-2-one (PubChem CID 54273326) has the molecular formula C21H31N5O2 and a molecular weight of 385.51 g/mol. Its IUPAC name is 7-piperidin-1-yl-3-(1-pyrimidin-4-ylpiperidin-4-yl)-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-2-one.
| Compound Name | 7-piperidin-1-yl-3-(1-pyrimidin-4-ylpiperidin-4-yl)-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 54273326 |
| Molecular Formula | C21H31N5O2 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.25 |
| IUPAC Name | 7-piperidin-1-yl-3-(1-pyrimidin-4-ylpiperidin-4-yl)-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-2-one |
| SMILES | O=C1OC2C(N3CCCCC3)CCCC2N1C1CCN(c2ccncn2)CC1 |
| InChI | InChI=1S/C21H31N5O2/c27-21-26(16-8-13-25(14-9-16)19-7-10-22-15-23-19)18-6-4-5-17(20(18)28-21)24-11-2-1-3-12-24/h7,10,15-18,20H,1-6,8-9,11-14H2 |
| InChIKey | RLRWDZBMHFIGKT-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 61.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |