C11H12Cl3N5 — CID 54274039
1-[amino-(2,4,6-trichloroanilino)methylidene]-2-cyclopropylguanidine (PubChem CID 54274039) has the molecular formula C11H12Cl3N5 and a molecular weight of 320.61 g/mol. Its IUPAC name is 1-[amino-(2,4,6-trichloroanilino)methylidene]-2-cyclopropylguanidine.
| Compound Name | 1-[amino-(2,4,6-trichloroanilino)methylidene]-2-cyclopropylguanidine |
|---|---|
| PubChem CID | 54274039 |
| Molecular Formula | C11H12Cl3N5 |
| Molecular Weight | 320.61 g/mol |
| Exact Mass | 319.02 |
| IUPAC Name | 1-[amino-(2,4,6-trichloroanilino)methylidene]-2-cyclopropylguanidine |
| SMILES | NC(=N/C(N)=N/C1CC1)Nc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C11H12Cl3N5/c12-5-3-7(13)9(8(14)4-5)18-11(16)19-10(15)17-6-1-2-6/h3-4,6H,1-2H2,(H5,15,16,17,18,19) |
| InChIKey | RMDPFMUDAWDLOO-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 88.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.61 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|