About 2,2-dibromoethanethioic S-acid
2,2-dibromoethanethioic S-acid (PubChem CID 54274330) has the molecular formula C2H2Br2OS
and a molecular weight of 233.91 g/mol. Its IUPAC name is 2,2-dibromoethanethioic S-acid.
Molecular Properties
| Compound Name | 2,2-dibromoethanethioic S-acid |
| PubChem CID | 54274330 |
| Molecular Formula | C2H2Br2OS |
| Molecular Weight | 233.91 g/mol |
| Exact Mass | 231.82 |
| IUPAC Name | 2,2-dibromoethanethioic S-acid |
| SMILES | O=C(S)C(Br)Br |
| InChI | InChI=1S/C2H2Br2OS/c3-1(4)2(5)6/h1H,(H,5,6) |
| InChIKey | RMIXLHAXNFXSIY-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 17.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.91 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dibromoethanethioic S-acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dibromoethanethioic S-acid?
The IUPAC name of 2,2-dibromoethanethioic S-acid (CID 54274330) is 2,2-dibromoethanethioic S-acid.
What is the SMILES notation for 2,2-dibromoethanethioic S-acid?
The canonical SMILES for 2,2-dibromoethanethioic S-acid is O=C(S)C(Br)Br.
What is the InChIKey of 2,2-dibromoethanethioic S-acid?
The InChIKey is RMIXLHAXNFXSIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H2Br2OS/c3-1(4)2(5)6/h1H,(H,5,6).
What are the key properties of 2,2-dibromoethanethioic S-acid?
2,2-dibromoethanethioic S-acid has a molecular weight of 233.91 g/mol, XLogP of 1.56, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dibromoethanethioic S-acid is sourced from PubChem (CID 54274330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).