About propan-2-yl 5-sulfanylpentanoate
propan-2-yl 5-sulfanylpentanoate (PubChem CID 54274530) has the molecular formula C8H16O2S
and a molecular weight of 176.28 g/mol. Its IUPAC name is propan-2-yl 5-sulfanylpentanoate.
Molecular Properties
| Compound Name | propan-2-yl 5-sulfanylpentanoate |
| PubChem CID | 54274530 |
| Molecular Formula | C8H16O2S |
| Molecular Weight | 176.28 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | propan-2-yl 5-sulfanylpentanoate |
| SMILES | CC(C)OC(=O)CCCCS |
| InChI | InChI=1S/C8H16O2S/c1-7(2)10-8(9)5-3-4-6-11/h7,11H,3-6H2,1-2H3 |
| InChIKey | RMMCFLLHZBFEJU-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 26.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.28 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze propan-2-yl 5-sulfanylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 5-sulfanylpentanoate?
The IUPAC name of propan-2-yl 5-sulfanylpentanoate (CID 54274530) is propan-2-yl 5-sulfanylpentanoate.
What is the SMILES notation for propan-2-yl 5-sulfanylpentanoate?
The canonical SMILES for propan-2-yl 5-sulfanylpentanoate is CC(C)OC(=O)CCCCS.
What is the InChIKey of propan-2-yl 5-sulfanylpentanoate?
The InChIKey is RMMCFLLHZBFEJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O2S/c1-7(2)10-8(9)5-3-4-6-11/h7,11H,3-6H2,1-2H3.
What are the key properties of propan-2-yl 5-sulfanylpentanoate?
propan-2-yl 5-sulfanylpentanoate has a molecular weight of 176.28 g/mol, XLogP of 2.04, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 5-sulfanylpentanoate is sourced from PubChem (CID 54274530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).