About 3,3-diethoxypropane-1,2-diol
3,3-diethoxypropane-1,2-diol (PubChem CID 542749) has the molecular formula C7H16O4
and a molecular weight of 164.20 g/mol. Its IUPAC name is 3,3-diethoxypropane-1,2-diol.
Molecular Properties
| Compound Name | 3,3-diethoxypropane-1,2-diol |
| PubChem CID | 542749 |
| Molecular Formula | C7H16O4 |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.10 |
| IUPAC Name | 3,3-diethoxypropane-1,2-diol |
| SMILES | CCOC(OCC)C(O)CO |
| InChI | InChI=1S/C7H16O4/c1-3-10-7(11-4-2)6(9)5-8/h6-9H,3-5H2,1-2H3 |
| InChIKey | BPNZBKXZVJVEJD-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 3,3-diethoxypropane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-diethoxypropane-1,2-diol?
The IUPAC name of 3,3-diethoxypropane-1,2-diol (CID 542749) is 3,3-diethoxypropane-1,2-diol.
What is the SMILES notation for 3,3-diethoxypropane-1,2-diol?
The canonical SMILES for 3,3-diethoxypropane-1,2-diol is CCOC(OCC)C(O)CO.
What is the InChIKey of 3,3-diethoxypropane-1,2-diol?
The InChIKey is BPNZBKXZVJVEJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16O4/c1-3-10-7(11-4-2)6(9)5-8/h6-9H,3-5H2,1-2H3.
What are the key properties of 3,3-diethoxypropane-1,2-diol?
3,3-diethoxypropane-1,2-diol has a molecular weight of 164.20 g/mol, XLogP of -0.26, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-diethoxypropane-1,2-diol is sourced from PubChem (CID 542749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).