About 1-cyano-2-methyl-3-[3-(1,3-thiazol-2-ylmethylamino)propyl]guanidine
1-cyano-2-methyl-3-[3-(1,3-thiazol-2-ylmethylamino)propyl]guanidine (PubChem CID 54275032) has the molecular formula C10H16N6S
and a molecular weight of 252.35 g/mol. Its IUPAC name is 1-cyano-2-methyl-3-[3-(1,3-thiazol-2-ylmethylamino)propyl]guanidine.
Molecular Properties
| Compound Name | 1-cyano-2-methyl-3-[3-(1,3-thiazol-2-ylmethylamino)propyl]guanidine |
| PubChem CID | 54275032 |
| Molecular Formula | C10H16N6S |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | 1-cyano-2-methyl-3-[3-(1,3-thiazol-2-ylmethylamino)propyl]guanidine |
| SMILES | C/N=C(\NC#N)NCCCNCc1nccs1 |
| InChI | InChI=1S/C10H16N6S/c1-12-10(16-8-11)15-4-2-3-13-7-9-14-5-6-17-9/h5-6,13H,2-4,7H2,1H3,(H2,12,15,16) |
| InChIKey | RMVBPSNFYAVSPQ-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-cyano-2-methyl-3-[3-(1,3-thiazol-2-ylmethylamino)propyl]guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyano-2-methyl-3-[3-(1,3-thiazol-2-ylmethylamino)propyl]guanidine?
The IUPAC name of 1-cyano-2-methyl-3-[3-(1,3-thiazol-2-ylmethylamino)propyl]guanidine (CID 54275032) is 1-cyano-2-methyl-3-[3-(1,3-thiazol-2-ylmethylamino)propyl]guanidine.
What is the SMILES notation for 1-cyano-2-methyl-3-[3-(1,3-thiazol-2-ylmethylamino)propyl]guanidine?
The canonical SMILES for 1-cyano-2-methyl-3-[3-(1,3-thiazol-2-ylmethylamino)propyl]guanidine is C/N=C(\NC#N)NCCCNCc1nccs1.
What is the InChIKey of 1-cyano-2-methyl-3-[3-(1,3-thiazol-2-ylmethylamino)propyl]guanidine?
The InChIKey is RMVBPSNFYAVSPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N6S/c1-12-10(16-8-11)15-4-2-3-13-7-9-14-5-6-17-9/h5-6,13H,2-4,7H2,1H3,(H2,12,15,16).
What are the key properties of 1-cyano-2-methyl-3-[3-(1,3-thiazol-2-ylmethylamino)propyl]guanidine?
1-cyano-2-methyl-3-[3-(1,3-thiazol-2-ylmethylamino)propyl]guanidine has a molecular weight of 252.35 g/mol, XLogP of 0.27, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyano-2-methyl-3-[3-(1,3-thiazol-2-ylmethylamino)propyl]guanidine is sourced from PubChem (CID 54275032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).