About tert-butyl (4R)-4-(hydroxymethyl)-1,3-thiazolidine-3-carboxylate
tert-butyl (4R)-4-(hydroxymethyl)-1,3-thiazolidine-3-carboxylate (PubChem CID 54275443) has the molecular formula C9H17NO3S
and a molecular weight of 219.31 g/mol. Its IUPAC name is tert-butyl (4R)-4-(hydroxymethyl)-1,3-thiazolidine-3-carboxylate.
Molecular Properties
| Compound Name | tert-butyl (4R)-4-(hydroxymethyl)-1,3-thiazolidine-3-carboxylate |
| PubChem CID | 54275443 |
| Molecular Formula | C9H17NO3S |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | tert-butyl (4R)-4-(hydroxymethyl)-1,3-thiazolidine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CSC[C@H]1CO |
| InChI | InChI=1S/C9H17NO3S/c1-9(2,3)13-8(12)10-6-14-5-7(10)4-11/h7,11H,4-6H2,1-3H3/t7-/m1/s1 |
| InChIKey | RNBXFVHAWRBLLH-SSDOTTSWSA-N |
| XLogP | 1.29 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl (4R)-4-(hydroxymethyl)-1,3-thiazolidine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (4R)-4-(hydroxymethyl)-1,3-thiazolidine-3-carboxylate?
The IUPAC name of tert-butyl (4R)-4-(hydroxymethyl)-1,3-thiazolidine-3-carboxylate (CID 54275443) is tert-butyl (4R)-4-(hydroxymethyl)-1,3-thiazolidine-3-carboxylate.
What is the SMILES notation for tert-butyl (4R)-4-(hydroxymethyl)-1,3-thiazolidine-3-carboxylate?
The canonical SMILES for tert-butyl (4R)-4-(hydroxymethyl)-1,3-thiazolidine-3-carboxylate is CC(C)(C)OC(=O)N1CSC[C@H]1CO.
What is the InChIKey of tert-butyl (4R)-4-(hydroxymethyl)-1,3-thiazolidine-3-carboxylate?
The InChIKey is RNBXFVHAWRBLLH-SSDOTTSWSA-N. The full InChI is InChI=1S/C9H17NO3S/c1-9(2,3)13-8(12)10-6-14-5-7(10)4-11/h7,11H,4-6H2,1-3H3/t7-/m1/s1.
What are the key properties of tert-butyl (4R)-4-(hydroxymethyl)-1,3-thiazolidine-3-carboxylate?
tert-butyl (4R)-4-(hydroxymethyl)-1,3-thiazolidine-3-carboxylate has a molecular weight of 219.31 g/mol, XLogP of 1.29, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (4R)-4-(hydroxymethyl)-1,3-thiazolidine-3-carboxylate is sourced from PubChem (CID 54275443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).