C17H21N3 — CID 54275851
2-[(6aR)-7-methyl-5,5a,6,6a,8,9,10,10a-octahydro-4H-indolo[4,3-fg]quinolin-9-yl]acetonitrile (PubChem CID 54275851) has the molecular formula C17H21N3 and a molecular weight of 267.38 g/mol. Its IUPAC name is 2-[(6aR)-7-methyl-5,5a,6,6a,8,9,10,10a-octahydro-4H-indolo[4,3-fg]quinolin-9-yl]acetonitrile.
| Compound Name | 2-[(6aR)-7-methyl-5,5a,6,6a,8,9,10,10a-octahydro-4H-indolo[4,3-fg]quinolin-9-yl]acetonitrile |
|---|---|
| PubChem CID | 54275851 |
| Molecular Formula | C17H21N3 |
| Molecular Weight | 267.38 g/mol |
| Exact Mass | 267.17 |
| IUPAC Name | 2-[(6aR)-7-methyl-5,5a,6,6a,8,9,10,10a-octahydro-4H-indolo[4,3-fg]quinolin-9-yl]acetonitrile |
| SMILES | CN1CC(CC#N)CC2c3cccc4c3C(CN4)C[C@H]21 |
| InChI | InChI=1S/C17H21N3/c1-20-10-11(5-6-18)7-14-13-3-2-4-15-17(13)12(9-19-15)8-16(14)20/h2-4,11-12,14,16,19H,5,7-10H2,1H3/t11?,12?,14?,16-/m1/s1 |
| InChIKey | RNJFTSIUJDRTGD-PGGGXIFMSA-N |
| XLogP | 2.92 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.38 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |