C43H49F3O6 — CID 54276435
3-[3-(7-ethoxy-1,1,1-trifluoroheptan-2-yl)oxycarbonyl-4-phenylphenyl]-4-(4-octoxyphenyl)benzoic acid (PubChem CID 54276435) has the molecular formula C43H49F3O6 and a molecular weight of 718.85 g/mol. Its IUPAC name is 3-[3-(7-ethoxy-1,1,1-trifluoroheptan-2-yl)oxycarbonyl-4-phenylphenyl]-4-(4-octoxyphenyl)benzoic acid.
| Compound Name | 3-[3-(7-ethoxy-1,1,1-trifluoroheptan-2-yl)oxycarbonyl-4-phenylphenyl]-4-(4-octoxyphenyl)benzoic acid |
|---|---|
| PubChem CID | 54276435 |
| Molecular Formula | C43H49F3O6 |
| Molecular Weight | 718.85 g/mol |
| Exact Mass | 718.35 |
| IUPAC Name | 3-[3-(7-ethoxy-1,1,1-trifluoroheptan-2-yl)oxycarbonyl-4-phenylphenyl]-4-(4-octoxyphenyl)benzoic acid |
| SMILES | CCCCCCCCOc1ccc(-c2ccc(C(=O)O)cc2-c2ccc(-c3ccccc3)c(C(=O)OC(CCCCCOCC)C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C43H49F3O6/c1-3-5-6-7-8-15-28-51-35-23-19-32(20-24-35)36-26-22-34(41(47)48)30-38(36)33-21-25-37(31-16-11-9-12-17-31)39(29-33)42(49)52-40(43(44,45)46)18-13-10-14-27-50-4-2/h9,11-12,16-17,19-26,29-30,40H,3-8,10,13-15,18,27-28H2,1-2H3,(H,47,48) |
| InChIKey | RNSZEZYXHOWFGX-UHFFFAOYSA-N |
| XLogP | 11.81 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.85 |
| LogP ≤ 5 | 11.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|