C18H30N2O4 — CID 54276439
[4-[3-[(1-amino-2-methylpropan-2-yl)amino]-2-hydroxypropoxy]-2,3,6-trimethylphenyl] acetate (PubChem CID 54276439) has the molecular formula C18H30N2O4 and a molecular weight of 338.45 g/mol. Its IUPAC name is [4-[3-[(1-amino-2-methylpropan-2-yl)amino]-2-hydroxypropoxy]-2,3,6-trimethylphenyl] acetate.
| Compound Name | [4-[3-[(1-amino-2-methylpropan-2-yl)amino]-2-hydroxypropoxy]-2,3,6-trimethylphenyl] acetate |
|---|---|
| PubChem CID | 54276439 |
| Molecular Formula | C18H30N2O4 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.22 |
| IUPAC Name | [4-[3-[(1-amino-2-methylpropan-2-yl)amino]-2-hydroxypropoxy]-2,3,6-trimethylphenyl] acetate |
| SMILES | CC(=O)Oc1c(C)cc(OCC(O)CNC(C)(C)CN)c(C)c1C |
| InChI | InChI=1S/C18H30N2O4/c1-11-7-16(12(2)13(3)17(11)24-14(4)21)23-9-15(22)8-20-18(5,6)10-19/h7,15,20,22H,8-10,19H2,1-6H3 |
| InChIKey | RNTAWNUUQNNOJW-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|