About (2,5-dihydroxypyrrol-1-yl) N-methylcarbamate
(2,5-dihydroxypyrrol-1-yl) N-methylcarbamate (PubChem CID 54276480) has the molecular formula C6H8N2O4
and a molecular weight of 172.14 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) N-methylcarbamate.
Molecular Properties
| Compound Name | (2,5-dihydroxypyrrol-1-yl) N-methylcarbamate |
| PubChem CID | 54276480 |
| Molecular Formula | C6H8N2O4 |
| Molecular Weight | 172.14 g/mol |
| Exact Mass | 172.05 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) N-methylcarbamate |
| SMILES | CNC(=O)On1c(O)ccc1O |
| InChI | InChI=1S/C6H8N2O4/c1-7-6(11)12-8-4(9)2-3-5(8)10/h2-3,9-10H,1H3,(H,7,11) |
| InChIKey | RNTNSOJFTYPVFF-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 83.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.14 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2,5-dihydroxypyrrol-1-yl) N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,5-dihydroxypyrrol-1-yl) N-methylcarbamate?
The IUPAC name of (2,5-dihydroxypyrrol-1-yl) N-methylcarbamate (CID 54276480) is (2,5-dihydroxypyrrol-1-yl) N-methylcarbamate.
What is the SMILES notation for (2,5-dihydroxypyrrol-1-yl) N-methylcarbamate?
The canonical SMILES for (2,5-dihydroxypyrrol-1-yl) N-methylcarbamate is CNC(=O)On1c(O)ccc1O.
What is the InChIKey of (2,5-dihydroxypyrrol-1-yl) N-methylcarbamate?
The InChIKey is RNTNSOJFTYPVFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O4/c1-7-6(11)12-8-4(9)2-3-5(8)10/h2-3,9-10H,1H3,(H,7,11).
What are the key properties of (2,5-dihydroxypyrrol-1-yl) N-methylcarbamate?
(2,5-dihydroxypyrrol-1-yl) N-methylcarbamate has a molecular weight of 172.14 g/mol, XLogP of -0.33, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-dihydroxypyrrol-1-yl) N-methylcarbamate is sourced from PubChem (CID 54276480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).