About 2-[4-[(2-cyclohexyl-4,5-dihydro-1H-imidazol-5-yl)methyl]piperazin-1-yl]pyrimidine
2-[4-[(2-cyclohexyl-4,5-dihydro-1H-imidazol-5-yl)methyl]piperazin-1-yl]pyrimidine (PubChem CID 54276505) has the molecular formula C18H28N6
and a molecular weight of 328.46 g/mol. Its IUPAC name is 2-[4-[(2-cyclohexyl-4,5-dihydro-1H-imidazol-5-yl)methyl]piperazin-1-yl]pyrimidine.
Molecular Properties
| Compound Name | 2-[4-[(2-cyclohexyl-4,5-dihydro-1H-imidazol-5-yl)methyl]piperazin-1-yl]pyrimidine |
| PubChem CID | 54276505 |
| Molecular Formula | C18H28N6 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.24 |
| IUPAC Name | 2-[4-[(2-cyclohexyl-4,5-dihydro-1H-imidazol-5-yl)methyl]piperazin-1-yl]pyrimidine |
| SMILES | c1cnc(N2CCN(CC3CN=C(C4CCCCC4)N3)CC2)nc1 |
| InChI | InChI=1S/C18H28N6/c1-2-5-15(6-3-1)17-21-13-16(22-17)14-23-9-11-24(12-10-23)18-19-7-4-8-20-18/h4,7-8,15-16H,1-3,5-6,9-14H2,(H,21,22) |
| InChIKey | RNTYNAYNWOHFLY-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[4-[(2-cyclohexyl-4,5-dihydro-1H-imidazol-5-yl)methyl]piperazin-1-yl]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[(2-cyclohexyl-4,5-dihydro-1H-imidazol-5-yl)methyl]piperazin-1-yl]pyrimidine?
The IUPAC name of 2-[4-[(2-cyclohexyl-4,5-dihydro-1H-imidazol-5-yl)methyl]piperazin-1-yl]pyrimidine (CID 54276505) is 2-[4-[(2-cyclohexyl-4,5-dihydro-1H-imidazol-5-yl)methyl]piperazin-1-yl]pyrimidine.
What is the SMILES notation for 2-[4-[(2-cyclohexyl-4,5-dihydro-1H-imidazol-5-yl)methyl]piperazin-1-yl]pyrimidine?
The canonical SMILES for 2-[4-[(2-cyclohexyl-4,5-dihydro-1H-imidazol-5-yl)methyl]piperazin-1-yl]pyrimidine is c1cnc(N2CCN(CC3CN=C(C4CCCCC4)N3)CC2)nc1.
What is the InChIKey of 2-[4-[(2-cyclohexyl-4,5-dihydro-1H-imidazol-5-yl)methyl]piperazin-1-yl]pyrimidine?
The InChIKey is RNTYNAYNWOHFLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H28N6/c1-2-5-15(6-3-1)17-21-13-16(22-17)14-23-9-11-24(12-10-23)18-19-7-4-8-20-18/h4,7-8,15-16H,1-3,5-6,9-14H2,(H,21,22).
What are the key properties of 2-[4-[(2-cyclohexyl-4,5-dihydro-1H-imidazol-5-yl)methyl]piperazin-1-yl]pyrimidine?
2-[4-[(2-cyclohexyl-4,5-dihydro-1H-imidazol-5-yl)methyl]piperazin-1-yl]pyrimidine has a molecular weight of 328.46 g/mol, XLogP of 1.55, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[(2-cyclohexyl-4,5-dihydro-1H-imidazol-5-yl)methyl]piperazin-1-yl]pyrimidine is sourced from PubChem (CID 54276505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).