C15H14ClN3O — CID 5427716
N-[(Z)-benzylideneamino]-2-(2-chloroanilino)acetamide (PubChem CID 5427716) has the molecular formula C15H14ClN3O and a molecular weight of 287.75 g/mol. Its IUPAC name is N-[(Z)-benzylideneamino]-2-(2-chloroanilino)acetamide.
| Compound Name | N-[(Z)-benzylideneamino]-2-(2-chloroanilino)acetamide |
|---|---|
| PubChem CID | 5427716 |
| Molecular Formula | C15H14ClN3O |
| Molecular Weight | 287.75 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | N-[(Z)-benzylideneamino]-2-(2-chloroanilino)acetamide |
| SMILES | O=C(CNc1ccccc1Cl)N/N=C\c1ccccc1 |
| InChI | InChI=1S/C15H14ClN3O/c16-13-8-4-5-9-14(13)17-11-15(20)19-18-10-12-6-2-1-3-7-12/h1-10,17H,11H2,(H,19,20)/b18-10- |
| InChIKey | RDLMGXNQMPHZQZ-ZDLGFXPLSA-N |
| XLogP | 2.90 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.75 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|