About 4-methoxycyclohexane-1,2,3-triol
4-methoxycyclohexane-1,2,3-triol (PubChem CID 54277163) has the molecular formula C7H14O4
and a molecular weight of 162.18 g/mol. Its IUPAC name is 4-methoxycyclohexane-1,2,3-triol.
Molecular Properties
| Compound Name | 4-methoxycyclohexane-1,2,3-triol |
| PubChem CID | 54277163 |
| Molecular Formula | C7H14O4 |
| Molecular Weight | 162.18 g/mol |
| Exact Mass | 162.09 |
| IUPAC Name | 4-methoxycyclohexane-1,2,3-triol |
| SMILES | COC1CCC(O)C(O)C1O |
| InChI | InChI=1S/C7H14O4/c1-11-5-3-2-4(8)6(9)7(5)10/h4-10H,2-3H2,1H3 |
| InChIKey | CUYYFJCNPJDVKY-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.18 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-methoxycyclohexane-1,2,3-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxycyclohexane-1,2,3-triol?
The IUPAC name of 4-methoxycyclohexane-1,2,3-triol (CID 54277163) is 4-methoxycyclohexane-1,2,3-triol.
What is the SMILES notation for 4-methoxycyclohexane-1,2,3-triol?
The canonical SMILES for 4-methoxycyclohexane-1,2,3-triol is COC1CCC(O)C(O)C1O.
What is the InChIKey of 4-methoxycyclohexane-1,2,3-triol?
The InChIKey is CUYYFJCNPJDVKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O4/c1-11-5-3-2-4(8)6(9)7(5)10/h4-10H,2-3H2,1H3.
What are the key properties of 4-methoxycyclohexane-1,2,3-triol?
4-methoxycyclohexane-1,2,3-triol has a molecular weight of 162.18 g/mol, XLogP of -1.12, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxycyclohexane-1,2,3-triol is sourced from PubChem (CID 54277163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).