C19H33N3O3Si — CID 54277593
prop-2-enyl (2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[1-(1H-pyrazol-5-yl)ethyl]pyrrolidine-1-carboxylate (PubChem CID 54277593) has the molecular formula C19H33N3O3Si and a molecular weight of 379.58 g/mol. Its IUPAC name is prop-2-enyl (2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[1-(1H-pyrazol-5-yl)ethyl]pyrrolidine-1-carboxylate.
| Compound Name | prop-2-enyl (2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[1-(1H-pyrazol-5-yl)ethyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 54277593 |
| Molecular Formula | C19H33N3O3Si |
| Molecular Weight | 379.58 g/mol |
| Exact Mass | 379.23 |
| IUPAC Name | prop-2-enyl (2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[1-(1H-pyrazol-5-yl)ethyl]pyrrolidine-1-carboxylate |
| SMILES | C=CCOC(=O)N1C[C@H](O[Si](C)(C)C(C)(C)C)C[C@@H]1C(C)c1ccn[nH]1 |
| InChI | InChI=1S/C19H33N3O3Si/c1-8-11-24-18(23)22-13-15(25-26(6,7)19(3,4)5)12-17(22)14(2)16-9-10-20-21-16/h8-10,14-15,17H,1,11-13H2,2-7H3,(H,20,21)/t14?,15-,17-/m1/s1 |
| InChIKey | ROMQXAUXZAPOHO-HOSQGPGDSA-N |
| XLogP | 4.30 |
| TPSA | 67.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.58 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|