C22H35N3 — CID 54277946
2,12,12-trimethyl-13-phenyldiazenyltrideca-5,9-dien-3-amine (PubChem CID 54277946) has the molecular formula C22H35N3 and a molecular weight of 341.54 g/mol. Its IUPAC name is 2,12,12-trimethyl-13-phenyldiazenyltrideca-5,9-dien-3-amine.
| Compound Name | 2,12,12-trimethyl-13-phenyldiazenyltrideca-5,9-dien-3-amine |
|---|---|
| PubChem CID | 54277946 |
| Molecular Formula | C22H35N3 |
| Molecular Weight | 341.54 g/mol |
| Exact Mass | 341.28 |
| IUPAC Name | 2,12,12-trimethyl-13-phenyldiazenyltrideca-5,9-dien-3-amine |
| SMILES | CC(C)C(N)CC=CCCC=CCC(C)(C)C/N=N/c1ccccc1 |
| InChI | InChI=1S/C22H35N3/c1-19(2)21(23)16-12-7-5-6-8-13-17-22(3,4)18-24-25-20-14-10-9-11-15-20/h7-15,19,21H,5-6,16-18,23H2,1-4H3/b12-7?,13-8?,25-24+ |
| InChIKey | ROSZBGOOUODJKZ-MPGXYZPVSA-N |
| XLogP | 6.45 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.54 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|