About 4,6-dibromo-1,3-dioxo-7-propyl-2-benzofuran-5-carboxylic acid
4,6-dibromo-1,3-dioxo-7-propyl-2-benzofuran-5-carboxylic acid (PubChem CID 54278372) has the molecular formula C12H8Br2O5
and a molecular weight of 392.00 g/mol. Its IUPAC name is 4,6-dibromo-1,3-dioxo-7-propyl-2-benzofuran-5-carboxylic acid.
Molecular Properties
| Compound Name | 4,6-dibromo-1,3-dioxo-7-propyl-2-benzofuran-5-carboxylic acid |
| PubChem CID | 54278372 |
| Molecular Formula | C12H8Br2O5 |
| Molecular Weight | 392.00 g/mol |
| Exact Mass | 389.87 |
| IUPAC Name | 4,6-dibromo-1,3-dioxo-7-propyl-2-benzofuran-5-carboxylic acid |
| SMILES | CCCc1c(Br)c(C(=O)O)c(Br)c2c1C(=O)OC2=O |
| InChI | InChI=1S/C12H8Br2O5/c1-2-3-4-5-6(12(18)19-11(5)17)9(14)7(8(4)13)10(15)16/h2-3H2,1H3,(H,15,16) |
| InChIKey | RPAMGQCLVFACLR-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.00 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 4,6-dibromo-1,3-dioxo-7-propyl-2-benzofuran-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-dibromo-1,3-dioxo-7-propyl-2-benzofuran-5-carboxylic acid?
The IUPAC name of 4,6-dibromo-1,3-dioxo-7-propyl-2-benzofuran-5-carboxylic acid (CID 54278372) is 4,6-dibromo-1,3-dioxo-7-propyl-2-benzofuran-5-carboxylic acid.
What is the SMILES notation for 4,6-dibromo-1,3-dioxo-7-propyl-2-benzofuran-5-carboxylic acid?
The canonical SMILES for 4,6-dibromo-1,3-dioxo-7-propyl-2-benzofuran-5-carboxylic acid is CCCc1c(Br)c(C(=O)O)c(Br)c2c1C(=O)OC2=O.
What is the InChIKey of 4,6-dibromo-1,3-dioxo-7-propyl-2-benzofuran-5-carboxylic acid?
The InChIKey is RPAMGQCLVFACLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8Br2O5/c1-2-3-4-5-6(12(18)19-11(5)17)9(14)7(8(4)13)10(15)16/h2-3H2,1H3,(H,15,16).
What are the key properties of 4,6-dibromo-1,3-dioxo-7-propyl-2-benzofuran-5-carboxylic acid?
4,6-dibromo-1,3-dioxo-7-propyl-2-benzofuran-5-carboxylic acid has a molecular weight of 392.00 g/mol, XLogP of 3.17, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-dibromo-1,3-dioxo-7-propyl-2-benzofuran-5-carboxylic acid is sourced from PubChem (CID 54278372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).